|
|
| | 2,5-DIHYDROXY-1,4-BENZOQUINONE Basic information |
| Product Name: | 2,5-DIHYDROXY-1,4-BENZOQUINONE | | Synonyms: | 4-dione,2,5-dihydroxy-5-cyclohexadiene-1;p-Benzoquinone, 2,5-dihydroxy-;2,5-Dihydroxybenzoquinone,98%;2,5-Dihydroxy-2,5-cyclohexadiene-1,4-dione;3,6-Dihydroxy-2,5-cyclohexadiene-1,4-dione;Dihydroxy-p-quinonate acid;2,5-Dihydroxy-1,4-benzoquinone,98%;2,5-Dihydroxy-1,4-benzoquinone, 98% 25GR | | CAS: | 615-94-1 | | MF: | C6H4O4 | | MW: | 140.09 | | EINECS: | 210-454-3 | | Product Categories: | Anthraquinones, Hydroquinones and Quinones;Benzoquinones;Alcohols;Monomers;Polymer Science | | Mol File: | 615-94-1.mol |  |
| | 2,5-DIHYDROXY-1,4-BENZOQUINONE Chemical Properties |
| Melting point | 235 °C (dec.)(lit.) | | Boiling point | 216.56°C (rough estimate) | | density | 1.4596 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Powder | | pka | pK1:2.71;pK2:5.18 (25°C) | | color | Ochre to brown | | Water Solubility | Soluble in water. | | BRN | 1939229 | | InChI | InChI=1S/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H | | InChIKey | QFSYADJLNBHAKO-UHFFFAOYSA-N | | SMILES | C1(=O)C=C(O)C(=O)C=C1O | | CAS DataBase Reference | 615-94-1(CAS DataBase Reference) | | EPA Substance Registry System | 2,5-Cyclohexadiene-1,4-dione, 2,5-dihydroxy- (615-94-1) |
| | 2,5-DIHYDROXY-1,4-BENZOQUINONE Usage And Synthesis |
| Chemical Properties | Ochre to brown powder | | Uses | 2,5-dihydroxy-1,4-benzoquinone dianion, and squarate as bridging ligands in the synthesis and magnetic properties of binuclear iron(III) complexes with oxalate. A Dinuclear 2,5-Dihydroxy-1,4-benzoquinone acts as a bridging ligand Ruthenium(II) Complex with the Dianion. | | Synthesis Reference(s) | Journal of the American Chemical Society, 67, p. 1034, 1945 DOI: 10.1021/ja01222a504 |
| | 2,5-DIHYDROXY-1,4-BENZOQUINONE Preparation Products And Raw materials |
|