1-Hydroxy-1,3-dihydro-2,1-benzoxaborole-6-carboxylic acid manufacturers
|
| | 1-Hydroxy-1,3-dihydro-2,1-benzoxaborole-6-carboxylic acid Basic information |
| Product Name: | 1-Hydroxy-1,3-dihydro-2,1-benzoxaborole-6-carboxylic acid | | Synonyms: | 1-Hydroxy-1,3-dihydro-2,1-benzoxaborole-6-carboxylic acid;5-Carboxy-2-(hydroxymethyl)benzeneboronicaciddehydrate;1,3-Dihydro-1-hydroxy-2,1-benzoxaborole-6-carboxylic acid;1-hydroxy-1,3-dihydrobenzo[c][1,2]oxaborole-6-carboxylic acid(WX191629);5-Carboxy-2-(hydroxymethyl)benzeneboronic acid dehydrate 95%;2,1-Benzoxaborole-6-carboxylic acid, 1,3-dihydro-1-hydroxy- | | CAS: | 1221343-14-1 | | MF: | C8H7BO4 | | MW: | 177.95 | | EINECS: | | | Product Categories: | | | Mol File: | 1221343-14-1.mol |  |
| | 1-Hydroxy-1,3-dihydro-2,1-benzoxaborole-6-carboxylic acid Chemical Properties |
| Melting point | 240-242 °C | | Boiling point | 375.0±52.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Acetone (Slightly, Heated), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.37±0.20(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H7BO4/c10-8(11)5-1-2-6-4-13-9(12)7(6)3-5/h1-3,12H,4H2,(H,10,11) | | InChIKey | VXDGEAYKTHEYPI-UHFFFAOYSA-N | | SMILES | B1(O)C2=CC(C(O)=O)=CC=C2CO1 |
| | 1-Hydroxy-1,3-dihydro-2,1-benzoxaborole-6-carboxylic acid Usage And Synthesis |
| Description | 1-Hydroxy-1,3-dihydro-2,1-benzoxaborole-6-carboxylic acid (HBCA) is a recently discovered carboxylic acid belonging to the family of boron-containing compounds. This novel acid has numerous potential applications in the fields of chemistry and biochemistry. Although the precise mechanism of action of HBCA is not entirely clear, it is postulated that it interacts with various molecules in the cell, such as proteins, causing changes in their function and structure. Consequently, these alterations can result in changes in the cell′s biochemical and physiological processes, ultimately affecting its behavior. |
| | 1-Hydroxy-1,3-dihydro-2,1-benzoxaborole-6-carboxylic acid Preparation Products And Raw materials |
|