| Company Name: |
HeFei ShenShen Medical Technology Co.,Ltd Gold
|
| Tel: |
15375050680; 15375050680 |
| Email: |
gdz2.71828@163.com |
| Products Intro: |
Product Name:(R)-1-(5-fluoro-2-iodophenyl)ethan-1-ol
CAS:1454852-98-2
Purity:HPLC＞99.0%，e.e.＞99.5% Package:1KG/包
|
|
| | (R)-1-(5-fluoro-2-iodophenyl)ethan-1-ol Basic information |
| Product Name: | (R)-1-(5-fluoro-2-iodophenyl)ethan-1-ol | | Synonyms: | (R)-1-(5-fluoro-2-iodophenyl)ethan-1-ol;Benzenemethanol, 5-fluoro-2-iodo-α-methyl-, (αR)-;EOS-60595;(R)-1-(5-Fluoro-2-iodophenyl)ethanol;(alphaR)-5-Fluoro-2-iodo-alpha-methylbenzenemethanol;(1R)-1-(5-fluoro-2-iodophenyl)ethan-1-ol;Benzenemethanol, 5-?fluoro-?2-?iodo-?α-?methyl-?, (αR)?-;(R)-1-(5-Fluoro-2-iodophenyl)ethan-1-ol - [F90688] | | CAS: | 1454852-98-2 | | MF: | C8H8FIO | | MW: | 266.05 | | EINECS: | | | Product Categories: | | | Mol File: | 1454852-98-2.mol |  |
| | (R)-1-(5-fluoro-2-iodophenyl)ethan-1-ol Chemical Properties |
| Boiling point | 275.7±30.0 °C(Predicted) | | density | 1.812±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 13.80±0.20(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1/C8H8FIO/c1-5(11)7-4-6(9)2-3-8(7)10/h2-5,11H,1H3/t5-/s3 | | InChIKey | GQGBQRLYBYFVAW-GQMHJJTINA-N | | SMILES | [C@@H](C1=CC(F)=CC=C1I)(O)C |&1:0,r| |
| | (R)-1-(5-fluoro-2-iodophenyl)ethan-1-ol Usage And Synthesis |
| | (R)-1-(5-fluoro-2-iodophenyl)ethan-1-ol Preparation Products And Raw materials |
|