|
|
| | 2-Bromo-4-(trifluoromethyl)pyridine Basic information |
| | 2-Bromo-4-(trifluoromethyl)pyridine Chemical Properties |
| Melting point | -21--20 °C | | Boiling point | 84-85 °C/14 mmHg | | density | 1.827 g/mL at 25 °C | | refractive index | n20/D 1.478 | | Fp | 164 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | clear liquid | | pka | -1.57±0.10(Predicted) | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C6H3BrF3N/c7-5-3-4(1-2-11-5)6(8,9)10/h1-3H | | InChIKey | WZVHLUMAQLUNTJ-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=CC(C(F)(F)F)=C1 | | CAS DataBase Reference | 175205-81-9(CAS DataBase Reference) |
| Hazard Codes | T,Xi | | Risk Statements | 25-36/37/38-37/38-36 | | Safety Statements | 26-36/37-45-37 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Toxic/Irritant | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Bromo-4-(trifluoromethyl)pyridine Usage And Synthesis |
| Uses | Regioselective deprotonation at C-3 with LDA followed by trapping with carbon dioxide provides the correspondin nicotinic acid. | | Uses | 2-Bromo-4-(trifluoromethyl)pyridine in used in the preparation of pyrazolopyridines as kinase LRRK2 inhibitors for treating and preventing cancer and neurodegenerative diseases. |
| | 2-Bromo-4-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|