|
|
| | 4'-Hydroxy-4-biphenylcarboxylic acid Basic information |
| | 4'-Hydroxy-4-biphenylcarboxylic acid Chemical Properties |
| Melting point | 295 °C (dec.)(lit.) | | Boiling point | 314.35°C (rough estimate) | | density | 1.1956 (rough estimate) | | refractive index | 1.5090 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in hot Methanol | | form | Liquid or Solid | | pka | 4.29±0.10(Predicted) | | color | Clear colorless to yellow | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C13H10O3/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h1-8,14H,(H,15,16) | | InChIKey | JTGCXYYDAVPSFD-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(cc1)-c2ccc(O)cc2 | | CAS DataBase Reference | 58574-03-1(CAS DataBase Reference) |
| | 4'-Hydroxy-4-biphenylcarboxylic acid Usage And Synthesis |
| Chemical Properties | Powder | | Uses | Intermediates of Liquid Crystals | | Uses | 4-(4-Hydroxyphenyl)benzoic acid Dyes and metabolites. | | Synthesis | 4'-Hydroxy-4-biphenylcarboxylic acid may be prepared by hydrolysis of the compound represented by the following general formula (2).
In formula 2, R1 denotes an alkyl, cycloalkyl or aryl radical containing 1 to 6 carbon atoms;
R denotes hydrogen or alkyl;
X denotes a leaving group selected from chlorine, bromine, iodine, mesyl, benzenesulfonyl, or toluenesulfonyl;
the quaternary ammonium group denotes an ammonium group bearing three identical or different alkyl groups or a pyridinium group. Hydrolysis is conducted in an alkaline aqueous solution or a mixed solution of an alkaline aqueous solution and an organic solvent. The alkali used for hydrolysis is selected from the group consisting of NaOH, KOH, CsOH, Na₂CO₃, K₂CO₃, and Cs₂CO₃-4-biphenylcarboxylic acid. The hydrolysis reaction is conducted at temperatures between 60 and 100°C. Compounds of formula (2) are prepared by reacting compounds of formula (3) with tertiary amines.
 |
| | 4'-Hydroxy-4-biphenylcarboxylic acid Preparation Products And Raw materials |
|