| Company Name: |
Hubei Jusheng Technology Co.,Ltd. |
| Tel: |
18871490254 |
| Email: |
linda@hubeijusheng.com |
| Products Intro: |
Product Name:(1R,2S,3R)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol
CAS:13185-73-4
Purity:0.99 Package:5KG;1KG
|
|
|
|
|
|
| | Fructosazine Basic information |
| Product Name: | Fructosazine | | Synonyms: | D-Arabino-1,1'-(2,5-pyrazinediyl)di-1,2,3,4-butanetetrol;(1R,1'R,2S,2'S,3R,3'R)-1,1'-(2,5-Pyrazinediyl)bis-1,2,3,4-butanetetrol;Fructosazine;1,1'-(Pyrazine-2,5-diyl)bis[(1R,2S,3R)-1,2,3,4-butanetetrol];1,1'-(Pyrazine-2,5-diyl)bis[(1R,2S,3R)-butane-1,2,3,4-tetraol];1,2,3,4-Butanetetrol, 1,1'-(2,5-pyrazinediyl)bis-, [1R-(1R*,1'*,2S*,2'S*,3R,3R*)];Aids123119;Aids-123119 | | CAS: | 13185-73-4 | | MF: | C12H20N2O8 | | MW: | 320.3 | | EINECS: | | | Product Categories: | Carbohydrates & Derivatives;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 13185-73-4.mol |  |
| | Fructosazine Chemical Properties |
| Melting point | >150°C (dec.) | | Boiling point | 764.9±60.0 °C(Predicted) | | density | 1.680±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Methanol (Slightly, Heated), Water (Slightly, Heated, Sonicated) | | form | Solid | | pka | 11.54±0.20(Predicted) | | color | Pale Beige to Brown | | InChI | InChI=1S/C12H20N2O8/c15-3-7(17)11(21)9(19)5-1-13-6(2-14-5)10(20)12(22)8(18)4-16/h1-2,7-12,15-22H,3-4H2/t7-,8-,9-,10-,11-,12-/m1/s1 | | InChIKey | NPWQIVOYGNUVEB-PAUJSFGCSA-N | | SMILES | C1([C@@H](O)[C@H](O)[C@H](O)CO)=NC=C([C@@H](O)[C@H](O)[C@H](O)CO)N=C1 |
| | Fructosazine Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | Fructosazine is used in the treatment of osteoarthritis and rheumatoid arthritis. |
| | Fructosazine Preparation Products And Raw materials |
|