1-PYRENEBUTANOL manufacturers
- 1-Pyrenebutanol 99%
-
- $15.00 / 1KG
-
2021-07-02
- CAS:67000-89-9
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1-PYRENEBUTANOL Basic information |
| | 1-PYRENEBUTANOL Chemical Properties |
| Melting point | 80-83 °C (lit.) | | Boiling point | 488.4±24.0 °C(Predicted) | | density | 1.217±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 15.15±0.10(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C20H18O/c21-13-2-1-4-14-7-8-17-10-9-15-5-3-6-16-11-12-18(14)20(17)19(15)16/h3,5-12,21H,1-2,4,13H2 | | InChIKey | MRENSFROWALQNU-UHFFFAOYSA-N | | SMILES | C1(CCCCO)=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 |
| | 1-PYRENEBUTANOL Usage And Synthesis |
| Uses | 1-Pyrenebutanol is a interfacial agent for bisphenol-A polycarbonate and multi-walled carbon nanotube composites. | | General Description | 1-Pyrenebutanol, an alcohol, is an organic building block. It participates in the polymerization of cyclic esters (lactide, δ-valerolactone and ε-caprolactone). |
| | 1-PYRENEBUTANOL Preparation Products And Raw materials |
|