PHENYL-BETA-D-GLUCURONIDE manufacturers
|
| | PHENYL-BETA-D-GLUCURONIDE Basic information |
| | PHENYL-BETA-D-GLUCURONIDE Chemical Properties |
| Melting point | 158-160°C | | Boiling point | 542.0±50.0 °C(Predicted) | | density | 1.587±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Sparingly, Sonicated) | | pka | 2.75±0.70(Predicted) | | form | Solid | | color | White to Pale Yellow | | Optical Rotation | [α]20/D 87±5°, c = 1% in H2O | | BRN | 89117 | | Stability: | Hygroscopic | | InChI | 1S/C12H14O7/c13-7-8(14)10(11(16)17)19-12(9(7)15)18-6-4-2-1-3-5-6/h1-5,7-10,12-15H,(H,16,17)/t7-,8-,9+,10-,12+/m0/s1 | | InChIKey | WVHAUDNUGBNUDZ-GOVZDWNOSA-N | | SMILES | O[C@@H]1[C@@H](O)[C@@H](O[C@@H]([C@H]1O)C(O)=O)Oc2ccccc2 | | CAS DataBase Reference | 17685-05-1 | | EPA Substance Registry System | .beta.-D-Glucopyranosiduronic acid, phenyl (17685-05-1) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10-21 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | PHENYL-BETA-D-GLUCURONIDE Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Phenyl-β-D-glucuronide has been used as a nonpeptide chromogen for testing biuret reagent and as a reference standard for phenol analysis in urine samples. | | Uses | A metabolite of Phenol. | | Definition | ChEBI: A beta-D-glucosiduronic acid that is the glucuronide conjugate of phenol. | | General Description | Phenyl-β-D-glucuronide is majorly used as a reference standard in chromatographic and mass spectrophotometry studies for quantifying glucuroconjugate metabolites in plasma and urine samples. |
| | PHENYL-BETA-D-GLUCURONIDE Preparation Products And Raw materials |
|