|
|
| | (2-Acetyl-4-Methylpentyl)triMethylaMMoniuM Iodide Basic information |
| | (2-Acetyl-4-Methylpentyl)triMethylaMMoniuM Iodide Chemical Properties |
| Melting point | 180-181 °C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C11H24NO.HI/c1-9(2)7-11(10(3)13)8-12(4,5)6;/h9,11H,7-8H2,1-6H3;1H/q+1;/p-1 | | InChIKey | QCTKXTXHDRLVAT-UHFFFAOYSA-M | | SMILES | CC(=O)C(C[N+](C)(C)C)CC(C)C.[I-] |
| | (2-Acetyl-4-Methylpentyl)triMethylaMMoniuM Iodide Usage And Synthesis |
| Uses | (2-Acetyl-4-methylpentyl)trimethylammonium Iodide is an impurity of Tetrabenazine (T284000), an antipsychotic. |
| | (2-Acetyl-4-Methylpentyl)triMethylaMMoniuM Iodide Preparation Products And Raw materials |
|