|
|
| | 2,3,5,6-Tetrafluorobenzoic acid Basic information | | Uses |
| Product Name: | 2,3,5,6-Tetrafluorobenzoic acid | | Synonyms: | 2,3,5,6-TETRAFLUOROBENZOIC ACID;RARECHEM AL BO 0266;2,3,5,6-Tetrafluorobenzoic acid,98%;4H-Tetrafluorobenzoic acid;Benzoic acid,2,3,5,6-tetrafluoro-;2,3,5,6-tetrafluorobenzoate | | CAS: | 652-18-6 | | MF: | C7H2F4O2 | | MW: | 194.08 | | EINECS: | 416-800-1 | | Product Categories: | Benzoic acid | | Mol File: | 652-18-6.mol |  |
| | 2,3,5,6-Tetrafluorobenzoic acid Chemical Properties |
| Melting point | 150-152 °C(lit.) | | Boiling point | 227.9±35.0 °C(Predicted) | | density | 1.5165 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | pka | 1.66±0.10(Predicted) | | color | White to almost white | | InChI | InChI=1S/C7H2F4O2/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1H,(H,12,13) | | InChIKey | KVLBXIOFJUWSJQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(F)C(F)=CC(F)=C1F | | CAS DataBase Reference | 652-18-6(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 38-41 | | Safety Statements | 22-26-37/39 | | WGK Germany | 1 | | Hazard Note | Irritant | | HazardClass | IRRITANT, CORROSIVE | | HS Code | 29163990 |
| | 2,3,5,6-Tetrafluorobenzoic acid Usage And Synthesis |
| Uses | 2,3,5,6-Tetrafluorobenzoic Acid is a useful research chemical. | | Chemical Properties | white to light yellow crystal powder |
| | 2,3,5,6-Tetrafluorobenzoic acid Preparation Products And Raw materials |
| Preparation Products | 2,3,5,6-Tetrafluorobenzyl alcohol-->2,3,5,6-tetrafluoro-4-mercapto-Benzoic acid-->2,3,5,6-TETRAFLUOROBENZYL BROMIDE-->1-BROMO-2,3,5,6-TETRAFLUOROBENZENE |
|