| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 18918157536; |
| Email: |
sales8178@energy-chemical.com |
|
| | Mono-ethyl succinate Basic information |
| | Mono-ethyl succinate Chemical Properties |
| Melting point | 8°C | | Boiling point | 248 °C(lit.) | | density | 1.141 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.432(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | pka | 4.45±0.17(Predicted) | | form | Liquid | | color | Clear colorless | | Specific Gravity | 1.146 (20℃) | | InChI | InChI=1S/C6H10O4/c1-2-10-6(9)4-3-5(7)8/h2-4H2,1H3,(H,7,8) | | InChIKey | LOLKAJARZKDJTD-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CCC(O)=O | | EPA Substance Registry System | Butanedioic acid, monoethyl ester (1070-34-4) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38-36/37 | | Safety Statements | 26 | | WGK Germany | 1 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29171900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Resp. Sens. 1
Skin Corr. 1B
Skin Sens. 1 |
| | Mono-ethyl succinate Usage And Synthesis |
| Definition | ChEBI: 4-Ethoxy-4-oxobutanoic acid is a fatty acid ester and a hemisuccinate. | | Synthesis Reference(s) | Synthetic Communications, 25, p. 739, 1995 DOI: 10.1080/00397919508011411 |
| | Mono-ethyl succinate Preparation Products And Raw materials |
|