- Barium metaphosphate
-
- $1.00 / 1KG
-
2025-12-12
- CAS:13762-83-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200000KG
- BARIUM METAPHOSPHATE
-
- $0.00 / 1kg
-
2025-06-20
- CAS:13762-83-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100tons
- Barium metaphosphate
-
- $0.00 / 1BAG
-
2025-04-26
- CAS:13762-83-9
- Min. Order: 1BAG
- Purity: ≥99.9%
- Supply Ability: 100 Tons
|
| | BARIUM METAPHOSPHATE Basic information |
| | BARIUM METAPHOSPHATE Chemical Properties |
| Melting point | 1560 °C (lit.) | | solubility | H2O: insoluble(lit.) | | form | Powder | | Water Solubility | Insoluble in water. Soluble in acids by a slow dissolution | | InChI | 1S/Ba.2HO3P/c;2*1-4(2)3/h;2*(H,1,2,3)/q+2;;/p-2 | | InChIKey | XNJIKBGDNBEQME-UHFFFAOYSA-L | | SMILES | [Ba++].[O-]P(=O)=O.[O-]P(=O)=O | | CAS DataBase Reference | 13762-83-9 |
| Hazard Codes | Xn | | Risk Statements | 20/22 | | Safety Statements | 28 | | RIDADR | UN 1564 6.1/PG 3 | | WGK Germany | 1 | | F | 3 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | BARIUM METAPHOSPHATE Usage And Synthesis |
| Chemical Properties | White powder. Slowly soluble in acids; insoluble in water. | | Uses | Glasses, porcelains, and enamels. | | Uses | Barium metaphosphate, used in glasses, porcelains, and enamels, as a flame retardant and in phosphors applications. | | Preparation | Barium metaphosphate can be prepared by the solidstate
reaction of metaphosphoric acid and the
hydroxide, oxide or carbonate of barium:
BaCO3 + HPO3 + heat ? Ba(PO3)2 +H2O + CO2
The best temperature to use is about 700°C. It has the
CAS number of 13762-83-9 and the molecular weight of
295.2709 g/mol. If diammonium phosphate is used
instead of solid metaphosphoric acid, the product is
not pure. Colored glasses are obtained caused by the
reduction of P-atoms in the phosphate anion by
hydrogen released from NH3 to form colloidal dispersions
of P4 which produce various colors in the glass.
b-Ba(PO3)2 is the final product. This compound can
also be prepared by the aqueous reactions:
NaPO3 (aq) + BaCl2 (aq) ? Ba(PO3)2 (solid) + NaCl (aq)
or
Ba(OH)2 (solid) + 2HPO3 (aq) ? Ba(PO3)2 (solid)
+ 2H2O
The dissolution and reaction involving HPO3 are
slow and should be carried out in a hot solution. Evaporation
at a low temperature (<15°C) serves to form the
crystals. The product involves several hydrates depending
upon the conditions of precipitation. Anhydrous
barium metaphosphate is a white porous powder or
granular material that is insoluble in water. |
| | BARIUM METAPHOSPHATE Preparation Products And Raw materials |
|