|
|
| | 2,3-Difluoroethoxybenzene Basic information | | Synthesis |
| Product Name: | 2,3-Difluoroethoxybenzene | | Synonyms: | 2,3-DIFLUORO-4-ETHOXYBENZENE;1-ETHOXY-2,3-DIFLUOROBENZENE;BENZENE, 1-ETHOXY-2,3-DIFLUORO-;2,3-Difluorophenyl ethyl ether;2,3-Difluoroethoxybenzene 1-Ethoxy-2,3-difluorobenzene;2,3-DIFLUOROETHOXYBE;1,2-bis(2-fluoroethoxy)benzene;2,3-difluoro-1-ethoxybenzene | | CAS: | 121219-07-6 | | MF: | C8H8F2O | | MW: | 158.15 | | EINECS: | 441-000-4 | | Product Categories: | Fluorine series;Aromatic Halides (substituted);Anisole | | Mol File: | 121219-07-6.mol |  |
| | 2,3-Difluoroethoxybenzene Chemical Properties |
| Boiling point | 178 | | density | 1.1784 | | vapor pressure | 4.13hPa at 20℃ | | refractive index | 1.4670-1.4710 | | Fp | 70.5 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | 254mg/L at 20℃ | | InChI | InChI=1S/C8H8F2O/c1-2-11-7-5-3-4-6(9)8(7)10/h3-5H,2H2,1H3 | | InChIKey | AVOGLGBKOFOSBN-UHFFFAOYSA-N | | SMILES | C1(OCC)=CC=CC(F)=C1F | | LogP | 2.82 at 23℃ | | CAS DataBase Reference | 121219-07-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | HS Code | 29093090 |
| | 2,3-Difluoroethoxybenzene Usage And Synthesis |
| Synthesis | solution of 2,3-difluorophenol (103.3 g, 793.9 mmol) in 2-butanone (770 ml) was added to potassium carbonate (128 g, 923 mmol). While stirring, a solution of iodoethane (180 g, 1154 mmol) in 2-butanone (350 ml) was added, and the mixture was stirred under reflux for 3 hours to suspend it. At room temperature, water (200 ml) and toluene (100 ml) were added to the reaction mixture. The separated organic phase was washed with 2N sodium hydroxide (100 ml) and brine (100 ml), respectively. The combined organic layers were dried with anhydrous magnesium sulfate, and the organic solvent was removed by vacuum evaporation. Finally, the residue was purified by vacuum distillation to obtain 2,3-DIFLUOROETHOXYBENZENE.
 Synthetic route of 2,3-DIFLUOROETHOXYBENZENE | | Chemical Properties | Clear colorless liquid | | Uses | 2,3-Difluoroethoxybenzene is a liquid that can be used as a synthetic intermediate for pharmaceutical molecules and liquid crystal materials.
| | Flammability and Explosibility | Not classified | | Chemical Reactivity |
2,3-Difluoroethoxybenzene is stable under recommended temperatures and pressures, it can reacts with strong oxidizing agents.
|
| | 2,3-Difluoroethoxybenzene Preparation Products And Raw materials |
|