| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
- Fenchyl acetate
-
- $1520.00
-
2026-04-21
- CAS:13851-11-1
- Purity:
- Supply Ability: 10g
|
| | FENCHYL ACETATE Basic information |
| Product Name: | FENCHYL ACETATE | | Synonyms: | FENCHYL ACETATE 96+% MIXTURE OF ALPHA&;FENCHYL ACETATE 90%;1,3,3-trimethyl-2-norbornanoacetate;1,3,3-trimethyl-bicyclo(2.2.1)heptan-2-oacetate;1,3,3-Trimethylbicyclo[2.2.1]hept-2-yl acetate;1,3,3-trimethyl-bicyclo[2.2.1]heptan-2-oacetate;1,3,3-TRIMETHYL-2-NORBONYLACETATE;3,3-Dimethyl-8,9-dinorbornan-2-ylacetat | | CAS: | 13851-11-1 | | MF: | C12H20O2 | | MW: | 196.29 | | EINECS: | 237-588-5 | | Product Categories: | | | Mol File: | 13851-11-1.mol |  |
| | FENCHYL ACETATE Chemical Properties |
| Boiling point | 220 °C(lit.) | | density | 0.98 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.456(lit.) | | FEMA | 3390 | 1,3,3-TRIMETHYL-2-NORBORNANYL ACETATE | | Fp | 168 °F | | Odor | at 100.00 %. fresh sweet pine fir herbal citrus | | Odor Type | balsamic | | biological source | synthetic | | Optical Rotation | [α]22/D +54°, neat | | JECFA Number | 1399 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C12H20O2/c1-8(13)14-10-11(2,3)9-5-6-12(10,4)7-9/h9-10H,5-7H2,1-4H3/t9-,10,12+/m1/s1 | | InChIKey | JUWUWIGZUVEFQB-MAZPRZIYSA-N | | SMILES | CC(=O)OC1C(C)(C)[C@@H]2CC[C@@]1(C)C2 | | LogP | 3.60 | | EPA Substance Registry System | Bicyclo[2.2.1]heptan-2-ol, 1,3,3-trimethyl-, acetate (13851-11-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | RB7660000 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | FENCHYL ACETATE Usage And Synthesis |
| Chemical Properties | Fenchyl acetate has a mild, sweet odor reminiscent of fr oil. | | Occurrence | Reported found in the oil from leaves and terminal branches of Juniperus rigida; in Seseli sibiricum; rosemary oil; fennel oil; oil of hinoki leaves Also reported found in ginger, Ocimum basilicum and mastic gum leaf oil | | Uses | Fenchyl acetate, a mixture of α- and β- contributes to the overall aroma and flavor profile of Alpinia calcarata . | | Preparation | By esterifcation of fenchyl alcohol with acetic anhydride in pyridine. | | Definition | ChEBI: Fenchyl acetate is a monoterpenoid. |
| | FENCHYL ACETATE Preparation Products And Raw materials |
|