- 2,3,4-Trifluoroaniline
-
- $8.00 / 1KG
-
2025-09-25
- CAS:3862-73-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,3,4-Trifluorobenzenamine Basic information |
| Product Name: | 2,3,4-Trifluorobenzenamine | | Synonyms: | 2,3,4-TFA;2,3,4-TRIFLUOROANILINE;2,3,4-TRIFLUOROBENZENAMINE;2,3,4-TRIFLUORANILINE;2,3,4-trifluoro-anilin;2,3,4-trifluoro-benzenamin;TRIFLUOROANILINE;2,3,4-Trifluoroaniline99% | | CAS: | 3862-73-5 | | MF: | C6H4F3N | | MW: | 147.1 | | EINECS: | 253-703-1 | | Product Categories: | Fluorine series;Anilines, Aromatic Amines and Nitro Compounds;Fluorobenzene;Amines;C2 to C6;Nitrogen Compounds | | Mol File: | 3862-73-5.mol |  |
| | 2,3,4-Trifluorobenzenamine Chemical Properties |
| Melting point | 14-15°C | | Boiling point | 92 °C/48 mmHg (lit.) | | density | 1.393 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.486(lit.) | | Fp | 155 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 2.25±0.10(Predicted) | | form | A liquid | | Specific Gravity | 1.393 | | color | Colorless to Light yellow to Light orange | | BRN | 3245609 | | InChI | InChI=1S/C6H4F3N/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2 | | InChIKey | WRDGNXCXTDDYBZ-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(F)C(F)=C1F | | CAS DataBase Reference | 3862-73-5(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, 2,3,4-trifluoro-C198 (3862-73-5) |
| Hazard Codes | Xn,N,Xi | | Risk Statements | 21/22-38-41-48/22-51/53 | | Safety Statements | 23-26-36/37/39-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | RTECS | CY1211500 | | F | 9 | | Hazard Note | Irritant | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29214210 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Irrit. 2 STOT RE 2 | | Toxicity | LD50 orl-rat: 699 mg/kg JACTDZ 1,61,90 |
| | 2,3,4-Trifluorobenzenamine Usage And Synthesis |
| Chemical Properties | CLEAR PURPLE TO BROWN LIQUID | | Uses | 2,3,4-Trifluoroaniline was used in preparation of diethyl 2-(2,3,4-trifluoro)-phenylaminomethylene malonate. | | General Description | Study on synthesis of 2,3,4-trifluoroaniline was reported. | | Safety Profile | Moderately toxic by ingestion. Askin and eye irritant. Combustible liquid. When heated todecomposition it emits toxic fumes of NOx and F. |
| | 2,3,4-Trifluorobenzenamine Preparation Products And Raw materials |
|