| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-(2,3-Dihydro-1,4-benzodioxin-2-ylcarbonyl)piperazine hydrochloride Basic information |
| Product Name: | 1-(2,3-Dihydro-1,4-benzodioxin-2-ylcarbonyl)piperazine hydrochloride | | Synonyms: | 1-(1,4-benzodioxan-2-ylcarbonyl)piperazine hydrochloride;N-[(1,4-Benzodioxin-2-yl)carbonyl]piperazine hydrochloride;2-(1-Piperazinylcarbonyl)-1,4-benzodioxane Hydrochloride;4-Benzodioxan-2-carbonyl)-piperazine hydrochloride;Doxazosin Related Compound A (20 mg) (N-(1,4-benzodioxane-2-carbonyl)piperazine hydrochloride);Methanone,(2,3-dihydro-1,4-benzodioxin-2-yl)-1-piperazinyl-, hydrochloride (1:1);(2,3-Dihydrobenzo[b][1,4]dioxin-2-yl)(piperazin-1-yl)Methanone hydrochloride;N-(1,4-Benzodioxane-2-carbonyl)piperazine Hydrochloride | | CAS: | 70918-74-0 | | MF: | C13H17ClN2O3 | | MW: | 284.74 | | EINECS: | 415-660-9 | | Product Categories: | (intermediate of doxazosin);(intermediate of doxazocin mesylate);Piperidines, Piperidones, Piperazines | | Mol File: | 70918-74-0.mol |  |
| | 1-(2,3-Dihydro-1,4-benzodioxin-2-ylcarbonyl)piperazine hydrochloride Chemical Properties |
| Melting point | 105-108°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | powder to crystal | | color | White to Almost white | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChI | InChI=1S/C13H16N2O3.ClH/c16-13(15-7-5-14-6-8-15)12-9-17-10-3-1-2-4-11(10)18-12;/h1-4,12,14H,5-9H2;1H | | InChIKey | TUKBWYXLYINULI-UHFFFAOYSA-N | | SMILES | C12=CC=CC=C1OCC(C(=O)N1CCNCC1)O2.Cl | | CAS DataBase Reference | 70918-74-0(CAS DataBase Reference) |
| Hazard Codes | T;N,Xi,N,T | | Risk Statements | 23/24/25-48/22-51/53 | | Safety Statements | 45-53-61 | | RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2934990002 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 2
STOT RE 2 Oral |
| | 1-(2,3-Dihydro-1,4-benzodioxin-2-ylcarbonyl)piperazine hydrochloride Usage And Synthesis |
| Uses | 1-[(2,3-Dihydro-1,4-benzodioxin-2-yl)carbonyl]piperazine Monohydrochloride (Doxazosin EP Impurity B) is an impurity of Doxazosin (D537500), a selective a1-adrenoceptor antagonist. Doxazosin relaxes smooth muscles of the prostate. |
| | 1-(2,3-Dihydro-1,4-benzodioxin-2-ylcarbonyl)piperazine hydrochloride Preparation Products And Raw materials |
|