CLOFILIUM TOSYLATE manufacturers
- Clofilium tosylate
-
- $48.00 / 5mg
-
2026-01-05
- CAS:92953-10-1
- Min. Order:
- Purity: 99.68%
- Supply Ability: 10g
|
| | CLOFILIUM TOSYLATE Basic information |
| Product Name: | CLOFILIUM TOSYLATE | | Synonyms: | CLOFILIUM TOSYLATE;4-chloro-n,n-diethyl-n-heptyl-benzenebutanaminiusaltwith4-methylbenzenes;4-CHLORO-N,N-DIETHYL-N-HEPTYLBENZENEBUTANAMINIUM TOSYLATE;N-(4-(4-CHLOROPHENYL)BUTYL)-N,N-DIETHYLHEPTAN-1-AMINIUM 4-METHYLBENZENESULFONATE;Clofilium tosylate,Potassium Channel,Clofilium,inhibit,Apoptosis,Inhibitor,KcsA;Clofilium tosylate, 10 mM in DMSO | | CAS: | 92953-10-1 | | MF: | C28H44ClNO3S | | MW: | 510.17 | | EINECS: | | | Product Categories: | | | Mol File: | 92953-10-1.mol |  |
| | CLOFILIUM TOSYLATE Chemical Properties |
| storage temp. | 4°C, protect from light | | solubility | H2O: soluble | | form | solid | | color | white | | Water Solubility | H2O: soluble | | InChIKey | MOQZYUUHIWPDQC-UHFFFAOYSA-M | | SMILES | Cc1ccc(cc1)S([O-])(=O)=O.CCCCCCC[N+](CC)(CC)CCCCc2ccc(Cl)cc2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | CY9040870 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | CLOFILIUM TOSYLATE Usage And Synthesis |
| Uses | Antiarrhythmic;K+ channel blocker | | Uses | Clofilium tosylate (CAS# 92953-10-1) is a pharmeceutical and is a pharmaceutical target for the treatment of malignant rhabdoid tumors. | | Biochem/physiol Actions | K+ channel blocker; cardiac depressant; anti-arrhythmic |
| | CLOFILIUM TOSYLATE Preparation Products And Raw materials |
|