|
|
| | CARPROPAMID Basic information |
| Product Name: | CARPROPAMID | | Synonyms: | CARPROPAMID;2,2-DICHLORO-N-[1-(4-CHLOROPHENYL)ETHYL]-1-ETHYL-3-METHYLCYCLOPROPANECARBOXAMIDE;CARPROPAMID <)>97 %;CARPROPAMIDE;carpropamid (bsi,paiso);CARPROPAMID STANDARD;Carpropamid 0;Carpropamid Solution,100ppm | | CAS: | 104030-54-8 | | MF: | C15H18Cl3NO | | MW: | 334.67 | | EINECS: | | | Product Categories: | | | Mol File: | 104030-54-8.mol |  |
| | CARPROPAMID Chemical Properties |
| Melting point | 152° | | Boiling point | 480.1±45.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 14.75±0.60(Predicted) | | BRN | 8395957 | | Henry's Law Constant | 8.4×102 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Major Application | agriculture environmental | | InChI | 1S/C15H18Cl3NO/c1-4-14(10(3)15(14,17)18)13(20)19-9(2)11-5-7-12(16)8-6-11/h5-10H,4H2,1-3H3,(H,19,20) | | InChIKey | RXDMAYSSBPYBFW-UHFFFAOYSA-N | | SMILES | CCC1(C(C)C1(Cl)Cl)C(=O)NC(C)c2ccc(Cl)cc2 |
| Hazard Codes | N | | Risk Statements | 51/53 | | Safety Statements | 61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 |
| | CARPROPAMID Usage And Synthesis |
| Uses | Fungicide. | | Definition | ChEBI: A cyclopropylcarboxamide obtained by formal condensation of the carboxy group of 2,2-dichloro-1-ethyl-3-methylcyclopropanecarboxylic acid with the amino group of 1-(4-chlorophenyl)ethylamine. A rice fungicide with specific action against Pyricularia
ryzae. It is not highly toxic to mammals but shows a moderate level of toxicity to birds, fish and earthworms. | | Metabolic pathway | Carpropamid is degraded gradually and in a similar
way in rice plants (including rice cell cultures),
mammals, typical paddy soils, and water. The
degradation process includes oxidation of the methyl
group of the cyclopropane ring or in the 4-chlorophenyl
ring. In mammals and plants, various water-soluble
conjugates are formed. In soils, carpropamid is
completely degraded to carbon dioxide. |
| | CARPROPAMID Preparation Products And Raw materials |
|