|
|
| | 1,1'-Carbonyl-di(1,2,4-triazole) Basic information |
| Product Name: | 1,1'-Carbonyl-di(1,2,4-triazole) | | Synonyms: | 1,1'-CARBONYLDI(1,2,4-TRIAZOLE);CDT ( N,N'-Carbonyl-di-(1,2,3-tiazole));1,1'-Carbonylbis(1,2,4-triazole);1,1'-Carbonyl-di-(1;N,N'-Carbonyl-di-(1,2,4-triazole);1,1'-Carbonylbis(1,2,4-triazole)
CDT;1,1'-Carbonyl-di-(1,2,4-triazole) technical, >=90% (T);1,1'-Carbonyldi(1,2,4-triazole)≥ 98% (Titration) | | CAS: | 41864-22-6 | | MF: | C5H4N6O | | MW: | 164.12 | | EINECS: | | | Product Categories: | | | Mol File: | 41864-22-6.mol |  |
| | 1,1'-Carbonyl-di(1,2,4-triazole) Chemical Properties |
| Melting point | 145-150 °C | | Boiling point | 429.1±28.0 °C(Predicted) | | density | 1.75±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Sparingly, Heated) | | form | Solid | | pka | -0.26±0.10(Predicted) | | color | White to Off-White | | BRN | 10250 | | Stability: | Hygroscopic, Moisture Sensitive | | Major Application | peptide synthesis | | InChI | InChI=1S/C5H4N6O/c12-5(10-3-6-1-8-10)11-4-7-2-9-11/h1-4H | | InChIKey | YHNUDLCUIKMNSN-UHFFFAOYSA-N | | SMILES | C(N1C=NC=N1)(N1C=NC=N1)=O |
| | 1,1'-Carbonyl-di(1,2,4-triazole) Usage And Synthesis |
| Chemical Properties | 1,1'-Carbonyl-di(1,2,4-triazole) is beige powder | | Uses |
1,1'-Carbonyl-di(1,2,4-triazole) is used in epoxidation reactions in organic synthesis. It is useful in preparing acyl triazolides from carboxylic acids. 1'-Carbonyl-di(1,2,4-triazole) is a reagent for peptide synthesis; preparation of thiol or selenol esters.
| | Uses | N,N''-Carbonyl-di-(1,2,4-triazole) is used in preparation of the bridged cycloformylpyridine derivative and their medical applications. | | reaction suitability | reaction type: Carbonylations | | Synthesis | 1,1'-Carbonyl-di(1,2,4-triazole) is preparate from triazole and phosgene in THF, in the presence of one equivalent of pyridine (80% yield)[1-2].
| | Precautions |
It may be stored in a desiccator over P2O5 at room temperature for many months without apparent decomposition.
| | References |
1. Beyerman, H. C.; Van Den Brink, W. M. RTC 1961, 80, 1372.
2. Gais, H.-J. AG(E) 1977, 16, 244.
|
| | 1,1'-Carbonyl-di(1,2,4-triazole) Preparation Products And Raw materials |
|