| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
(-)-3-(Trifluoroacetyl)camphor manufacturers
|
| | (-)-3-(Trifluoroacetyl)camphor Basic information |
| Product Name: | (-)-3-(Trifluoroacetyl)camphor | | Synonyms: | (-)-3-(TRIFLUOROACETYL)CAMPHOR 98;(-)-3-(Trifluoroacetyl)caMphor 98%;Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-3-(2,2,2-trifluoroacetyl)-, (1S,4S)-;(-)-3-(Trifluoroacetyl)camphor;()-3-(Trifluoroacetyl)camphor;(1S,4S)-1,7,7-Trimethyl-3-(Trifluoroacetyl)Bicyclo[2.2.1]Heptan-2-One;(-)-3-(TRIFLUOROACETYL)CAMPHOR 98;1,7,7-trimethyl-3-(2,2,2-trifluoroacetyl)bicyclo[2.2.1]heptan-2-one | | CAS: | 207742-84-5 | | MF: | C12H15F3O2 | | MW: | 248.24 | | EINECS: | | | Product Categories: | | | Mol File: | 207742-84-5.mol |  |
| | (-)-3-(Trifluoroacetyl)camphor Chemical Properties |
| Boiling point | 213.847±0.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.172 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.451(lit.) | | Fp | 180 °F | | pka | 7.744±0.60(predicted) | | Optical Rotation | [α]19/D 148.0°, c = 2.5 in methylene chloride | | InChI | InChI=1S/C12H15F3O2/c1-10(2)6-4-5-11(10,3)8(16)7(6)9(17)12(13,14)15/h6-7H,4-5H2,1-3H3/t6-,7,11+/m0/s1 | | InChIKey | ISLOIHOAZDSEAJ-NSMOOJLNSA-N | | SMILES | [C@@]12(C)C(C)(C)[C@@]([H])(CC1)C(C(C(F)(F)F)=O)C2=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (-)-3-(Trifluoroacetyl)camphor Usage And Synthesis |
| | (-)-3-(Trifluoroacetyl)camphor Preparation Products And Raw materials |
|