- (+)-10-CAMPHORSULFONIMINE
-
- $9.80 / 1.79999995231628KG
-
2020-01-14
- CAS:107869-45-4
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | (+)-10-CAMPHORSULFONIMINE Basic information |
| Product Name: | (+)-10-CAMPHORSULFONIMINE | | Synonyms: | (1R)-(+)-CAMPHORSULFONYLIMINE;(1R)-(+)-(10-CAMPHORSULFONYL)IMINE;(3aR,6S)-8,8-Dimethyl-4,5,6,7-tetrahydro-3H-3a,6-methanobenzo[c]isothiazole 2,2-dioxide;(1R)-(+)-10,10-Dimethyl-3-thia-4-azatricyclo[5.2.1.01,5]dec-4-ene 3,3-dioxide;(1R)-(+)-Camphorsulfonylimine, (3aR)-(+)-4,5,6,7-Tetrahydro-8,8-dimethyl-3H-3a,6-methano-2,1-benzisothiazole-2,2-dioxide;(3aR,6S)-4,5,6,7-Tetrahydro-8,8-dimethyl-3H-3a,6-methano-2,1-benzisothiazole 2,2-dioxide;(7R)-(+)-10,10-Dimethyl-3-thia-4-azatricyclo[5.2.1.0(1,5)]dec-4-ene 3,3-Dioxide
(3aR)-(+)-4,5,6,7-Tetrahydro-8,8-dimethyl-3H-3a,6-methano-2,1-benzisothiazole 2,2-Dioxide;(3AR)-(+)-4,5,6,7-TETRAHYDRO-8,8-DIMETHYL-3H-3A,6-METHANO-2,1-BENZISOTHIAZOLE 2,2-DIOXIDE | | CAS: | 107869-45-4 | | MF: | C10H15NO2S | | MW: | 213.3 | | EINECS: | 621-464-6 | | Product Categories: | Chiral Reagents;Bicyclic Monoterpenes;Biochemistry;Terpenes;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 107869-45-4.mol |  |
| | (+)-10-CAMPHORSULFONIMINE Chemical Properties |
| Melting point | 229-230 °C(lit.) | | Boiling point | 337℃ | | density | 1.50 | | refractive index | 31 ° (C=2, CHCl3) | | Fp | 158℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetone, Dichloromethane, Hot Methanol | | form | Solid | | pka | -1.63±0.40(Predicted) | | color | White Cyrstalline | | InChI | InChI=1S/C10H15NO2S/c1-9(2)7-3-4-10(9)6-14(12,13)11-8(10)5-7/h7H,3-6H2,1-2H3/t7-,10-/m0/s1 | | InChIKey | ZAHOEBNYVSWBBW-XVKPBYJWSA-N | | SMILES | N1=C2[C@@]3(C(C)(C)[C@]([H])(C2)CC3)CS1(=O)=O | | CAS DataBase Reference | 107869-45-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2934.99.9001 |
| | (+)-10-CAMPHORSULFONIMINE Usage And Synthesis |
| Chemical Properties | White Cyrstalline Solid | | Uses | (+)-10-CAMPHORSULFONIMINE is a useful synthetic intermediate,it is used for asymmetric hydroxylation. | | Uses | A useful synthetic intermediate. Used for asymmetric hydroxylation. |
| | (+)-10-CAMPHORSULFONIMINE Preparation Products And Raw materials |
|