|
|
| | 4-FLUORO-2-NITROBENZYL BROMIDE Basic information |
| Product Name: | 4-FLUORO-2-NITROBENZYL BROMIDE | | Synonyms: | 4-FLUORO-2-NITROBENZYL BROMIDE;1-Bromomethyl-4-fluoro-2-nitrobenzene;2-Bromomethyl-5-fluoronitrobenzene;1-(Bromomethyl)-4-fluoro-2-nitrobenzene, alpha-Bromo-4-fluoro-2-nitrotoluene;2-Nitro-4-fluorobenzyl bromide;4-Fluoro-2-nitrobenzyl bromide 98%;Benzene, 1-(bromomethyl)-4-fluoro-2-nitro- | | CAS: | 76437-44-0 | | MF: | C7H5BrFNO2 | | MW: | 234.02 | | EINECS: | | | Product Categories: | Fluorine series | | Mol File: | 76437-44-0.mol |  |
| | 4-FLUORO-2-NITROBENZYL BROMIDE Chemical Properties |
| Boiling point | 273℃ | | density | 1.689 g/mL at 25 °C | | refractive index | 1. | | Fp | 113℃ | | storage temp. | 2-8°C | | form | liquid | | color | Red/tan | | InChI | 1S/C7H5BrFNO2/c8-4-5-1-2-6(9)3-7(5)10(11)12/h1-3H,4H2 | | InChIKey | NBRNHHKYVFAXCZ-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(F)ccc1CBr |
| Hazard Codes | C | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8 / PGII | | WGK Germany | 3 | | HS Code | 2904990090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Skin Corr. 1B |
| | 4-FLUORO-2-NITROBENZYL BROMIDE Usage And Synthesis |
| Chemical Properties | Colorless liquid |
| | 4-FLUORO-2-NITROBENZYL BROMIDE Preparation Products And Raw materials |
|