|
|
| | 2-chloro-1-nitro-3-(trifluoromethyl)benzene Basic information |
| Product Name: | 2-chloro-1-nitro-3-(trifluoromethyl)benzene | | Synonyms: | 2-chloro-1-nitro-3-(trifluoromethyl)benzene;2-Chloro-3-trifluoromethyl-1-nitrobenzene;1-Chloro-2-nitro-6-(trifluoroMethyl)benzene;Benzene,2-chloro-1-nitro-3-(trifluoromethyl)-;2-Chloro-3-nitrobenzotrifluoride;2-Chloro-3-nitrobenzotrifluori;2-Chloro-3-trifluoromethylnitrobenzene;2-chloro-3-nitrotrifluorotoluene | | CAS: | 39974-35-1 | | MF: | C7H3ClF3NO2 | | MW: | 225.55 | | EINECS: | 254-724-9 | | Product Categories: | | | Mol File: | 39974-35-1.mol |  |
| | 2-chloro-1-nitro-3-(trifluoromethyl)benzene Chemical Properties |
| Melting point | 25-30℃ | | Boiling point | 234.6±35.0 °C(Predicted) | | density | 1.537±0.06 g/cm3(Predicted) | | Fp | >110°(230°F) | | storage temp. | 2-8°C | | form | Solid | | Appearance | White to off-white Solid | | Exposure limits | ACGIH: TWA 2.5 mg/m3 NIOSH: IDLH 250 mg/m3 | | InChI | 1S/C7H3ClF3NO2/c8-6-4(7(9,10)11)2-1-3-5(6)12(13)14/h1-3H | | InChIKey | TWABRHQBRWLSSE-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cccc(c1Cl)C(F)(F)F | | CAS DataBase Reference | 39974-35-1 |
| WGK Germany | 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | 2-chloro-1-nitro-3-(trifluoromethyl)benzene Usage And Synthesis |
| Uses | 2-Chloro-1-nitro-3-(trifluoromethyl)benzene is used in the synthesis of highly potent and orally effective Inhibitors of FABP4 for anti-inflammation. |
| | 2-chloro-1-nitro-3-(trifluoromethyl)benzene Preparation Products And Raw materials |
|