- Light Stabilizer 114
-
- $5.00 / 1KG
-
2023-05-24
- CAS:42774-15-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | N,N'-Bis(2,2,6,6-tetramethyl-4-piperidinyl)-1,3-benzenedicarboxamide Basic information |
| Product Name: | N,N'-Bis(2,2,6,6-tetramethyl-4-piperidinyl)-1,3-benzenedicarboxamide | | Synonyms: | 1,3-Benzendicarboxamide,N,N'-Bis(2,2,6,6-Tetramethyl-4-Piperidinyl);N,N''-BIS(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL)-1,3-BENZENEDICARBOXAMIDE;Nylostab S-Eed;Polyamide Stabilizer;1,3-Benzenedicarboxamide, N,N-bis(2,2,6,6-tetramethyl-4-piperidinyl)-;1,3-Benzenedicarboxamide,N,N'-bis(2,2,6,6-tetramethyl-4-piperdinyl);N,N'-bis(2,2,6,6-tetramethyl-4-piperidyl)isophthalamide;Light stabilizer 438 | | CAS: | 42774-15-2 | | MF: | C26H42N4O2 | | MW: | 442.64 | | EINECS: | 419-710-0 | | Product Categories: | | | Mol File: | 42774-15-2.mol |  |
| | N,N'-Bis(2,2,6,6-tetramethyl-4-piperidinyl)-1,3-benzenedicarboxamide Chemical Properties |
| Melting point | >270°C (dec.) | | Boiling point | 605.1±55.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 13.67±0.60(Predicted) | | color | White to Off-White | | Water Solubility | 139mg/L at 30℃ | | InChIKey | OYNOCRWQLLIRON-UHFFFAOYSA-N | | SMILES | C1(C(NC2CC(C)(C)NC(C)(C)C2)=O)=CC=CC(C(NC2CC(C)(C)NC(C)(C)C2)=O)=C1 | | LogP | 1.12 at 20℃ | | EPA Substance Registry System | 1,3-Benzenedicarboxamide, N,N'-bis(2,2,6,6-tetramethyl-4-piperidinyl)- (42774-15-2) |
| | N,N'-Bis(2,2,6,6-tetramethyl-4-piperidinyl)-1,3-benzenedicarboxamide Usage And Synthesis |
| Uses | (1) N,N'-Bis(2,2,6,6-tetramethyl-4-piperidinyl)-1,3-benzenedicarboxamide can be used to improve nylon melt stability, thereby improving nylon processability, reducing fiber breakage rate, and improving product quality.
(2) It has a long-term stabilizing effect on light, heat, oxidation, etc., and can improve the dispersibility of fillers and pigments in nylon.
(3) Improve pigment tinting strength, improve pigment stability, and enhance the dyeability of nylon fibers. | | Flammability and Explosibility | Non flammable |
| | N,N'-Bis(2,2,6,6-tetramethyl-4-piperidinyl)-1,3-benzenedicarboxamide Preparation Products And Raw materials |
|