|
|
| | bis (benzyl diphenylphosphine) iminium chloride Basic information | | Uses |
| Product Name: | bis (benzyl diphenylphosphine) iminium chloride | | Synonyms: | bis (benzyl diphenylphosphine) iminium chloride;diphenylphosphinyl Hydroquinone;2-(DIPHENYLPHOSPHINYL)HYDROQUINONE (PPQ);2-(Diphenylphosphinyl)hydroquinone;1,4-Benzenediol,2-(diphenylphosphinyl)-;2-diphenylphosphorylbenzene-1,4-diol;DHPDPPO;2,5-Dihydroxytriphenylphosphine Oxide | | CAS: | 13291-46-8 | | MF: | C18H15O3P | | MW: | 310.28 | | EINECS: | | | Product Categories: | | | Mol File: | 13291-46-8.mol |  |
| | bis (benzyl diphenylphosphine) iminium chloride Chemical Properties |
| Melting point | 214 °C | | Boiling point | 573.7±50.0 °C(Predicted) | | density | 1.34 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | pka | 9.08±0.43(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C18H15O3P/c19-14-11-12-17(20)18(13-14)22(21,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,19-20H | | InChIKey | LLOXZCFOAUCDAE-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(O)C=C1P(C1=CC=CC=C1)(C1=CC=CC=C1)=O |
| RIDADR | UN 3077 9/PG III | | HazardClass | 9 | | PackingGroup | III | | HS Code | 2931499090 |
| | bis (benzyl diphenylphosphine) iminium chloride Usage And Synthesis |
| Uses | Diphenylanthraquinone oxide is an organophosphorus compound that can be used as an organic reagent. | | Description | Bis(benzyldiphenylphosphine)imine chloride is a white to nearly white powder crystal, an organic phosphine compound, which can be used as an organic reagent. |
| | bis (benzyl diphenylphosphine) iminium chloride Preparation Products And Raw materials |
|