Perfluoro-tert-butanol manufacturers
- PERFLUORO-TERT-BUTANOL
-
- $1.50
-
2026-05-15
- CAS:2378-02-1
- Min. Order: 1g
- Purity: 99.0% Min
- Supply Ability: 100 Tons
|
| | Perfluoro-tert-butanol Basic information |
| Product Name: | Perfluoro-tert-butanol | | Synonyms: | HEXAFLUORO-2-TRIFLUOROMETHYL-2-PROPANOL;NONAFLUORO-T-BUTYL ALCOHOL;1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)-2-propano;2-Propanol, 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)-;Ethanol, 2,2,2-trifluoro-1,1-bis(trifluoromethyl)-;Nonafluor-terc.butanol;Perfluoro-t-butanol,min.97%;Nonafluoro-tert-butanol 99% | | CAS: | 2378-02-1 | | MF: | C4HF9O | | MW: | 236.04 | | EINECS: | 219-157-3 | | Product Categories: | organofluorine compounds | | Mol File: | 2378-02-1.mol |  |
| | Perfluoro-tert-butanol Chemical Properties |
| Melting point | -17°C | | Boiling point | 45 °C (lit.) | | density | 1.693 g/mL at 25 °C (lit.) | | vapor pressure | 5.19 psi ( 20 °C) | | refractive index | n20/D 1.3(lit.) | | Fp | 44-45°C | | storage temp. | Keep Cold | | form | Liquid | | pka | 7.05±0.53(Predicted) | | color | Clear colorless | | Specific Gravity | 1.693 | | BRN | 1841640 | | InChI | 1S/C4HF9O/c5-2(6,7)1(14,3(8,9)10)4(11,12)13/h14H | | InChIKey | XZNOAVNRSFURIR-UHFFFAOYSA-N | | SMILES | OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F | | CAS DataBase Reference | 2378-02-1(CAS DataBase Reference) | | EPA Substance Registry System | 2-Propanol, 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)- (2378-02-1) |
| Hazard Codes | Xn,Xi,T | | Risk Statements | 20-36/37/38-23 | | Safety Statements | 26-45-36/37 | | RIDADR | UN 2810 6.1/PG 2 | | WGK Germany | 3 | | RTECS | UB6452700 | | Hazard Note | Toxic | | HazardClass | KEEP COLD, TOXIC | | HazardClass | 6.1 | | HS Code | 29062990 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Inhalation
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | mouse,LC50,inhalation,10230mg/m3/2H (10230mg/m3),"Prehled Prumyslove Toxikologie; Organicke Latky," Marhold, J., Prague, Czechoslovakia, Avicenum, 1986Vol. -, Pg. 521, 1986. |
| | Perfluoro-tert-butanol Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Nonafluoro-tert-butyl Alcohol is used in production of SO2-based electrolytes for rechargeable battery cells with improved stability, improved performance, low production cost. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 57, p. 1124, 1992 DOI: 10.1021/jo00030a018 | | General Description | Nonafluoro-tert-butyl alcohol is also referred as perfluorotertiarybutanol and ′artificial blood′. |
| | Perfluoro-tert-butanol Preparation Products And Raw materials |
|