| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N,N-Dibenzyl-L-serine methyl ester Basic information |
| Product Name: | N,N-Dibenzyl-L-serine methyl ester | | Synonyms: | N,N-Dibenzyl-L-serine methyl ester 97%;(S)-2-DIBENZYLAMINO-3-HYDROXYPROPIONIC ACID METHYL ESTER;L-Serine, N,N-bis(phenylmethyl)-, methyl ester;Methyl dibenzyl-L-serinate;N,N-Dibenzyl-L-serine methyl ester;N,N-Bis(phenylmethyl)-L-serine methyl ester;N,N-Dibenzyl-L-serine methyl ester | | CAS: | 88099-67-6 | | MF: | C18H21NO3 | | MW: | 299.36 | | EINECS: | | | Product Categories: | | | Mol File: | 88099-67-6.mol |  |
| | N,N-Dibenzyl-L-serine methyl ester Chemical Properties |
| density | 1.201 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5550(lit.) | | Optical Rotation | [α]24/D -110°, c =1% in methanol | | Major Application | peptide synthesis | | InChI | 1S/C18H21NO3/c1-22-18(21)17(14-20)19(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11,17,20H,12-14H2,1H3/t17-/m0/s1 | | InChIKey | VAAGDABRDJFHHK-KRWDZBQOSA-N | | SMILES | COC(=O)[C@H](CO)N(Cc1ccccc1)Cc2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N,N-Dibenzyl-L-serine methyl ester Usage And Synthesis |
| | N,N-Dibenzyl-L-serine methyl ester Preparation Products And Raw materials |
|