1-[Bis[3-(dimethylamino)propyl]amino]-2-propanol manufacturers
|
| 1-[Bis[3-(dimethylamino)propyl]amino]-2-propanol Basic information |
| 1-[Bis[3-(dimethylamino)propyl]amino]-2-propanol Chemical Properties |
Boiling point | 290 °C(lit.) | density | 0.89 g/mL at 25 °C(lit.) | vapor pressure | 1.7Pa at 20℃ | refractive index | n20/D 1.459(lit.) | Fp | >230 °F | pka | 14.81±0.20(Predicted) | Water Solubility | 100g/L at 20℃ | InChI | InChI=1S/C13H31N3O/c1-13(17)12-16(10-6-8-14(2)3)11-7-9-15(4)5/h13,17H,6-12H2,1-5H3 | InChIKey | NWDRKFORNVPWLY-UHFFFAOYSA-N | SMILES | C(N(CCCN(C)C)CCCN(C)C)C(O)C | LogP | 0.587 at 22.6℃ | EPA Substance Registry System | 2-Propanol, 1-[bis[3-(dimethylamino)propyl]amino]- (67151-63-7) |
| 1-[Bis[3-(dimethylamino)propyl]amino]-2-propanol Usage And Synthesis |
Uses | Catalyst for low-density packaging foams. Contains terminal hydroxyl groups that can react with isocyanates. | Flammability and Explosibility | Not classified |
| 1-[Bis[3-(dimethylamino)propyl]amino]-2-propanol Preparation Products And Raw materials |
|