- TRIHEXYLSILANE
-
- $1.00
-
2019-07-06
- CAS:2929-52-4
- Min. Order: 1KG
- Purity: 99%
|
| | TRIHEXYLSILANE Basic information |
| | TRIHEXYLSILANE Chemical Properties |
| Boiling point | 160.5-161 °C (lit.) | | density | 0.799 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.448(lit.) | | Fp | >230 °F | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 0.799 | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | InChI | 1S/C18H40Si/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h19H,4-18H2,1-3H3 | | InChIKey | IBNSYFQZHBBNLR-UHFFFAOYSA-N | | SMILES | CCCCCC[SiH](CCCCCC)CCCCCC | | EPA Substance Registry System | Silane, trihexyl- (2929-52-4) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39-38-51-36/37 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | TRIHEXYLSILANE Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Reactant for:
- Enantioselective Si-H insertion
- Regio- and stereoselective oxidation into silanols
- Asymmetric carbenoid insertion of diazoacetates into the silicon-hydrogen bond
- Hydrosilylation of carbon dioxide
Catalyst for hydrodefluorination leading to the synthesis of hydrocarbons | | Application | Reactivity similar to that of triethylsilane but has higher
boiling point and produces a higher boiling by-product. | | reaction suitability | reagent type: reductant |
| | TRIHEXYLSILANE Preparation Products And Raw materials |
|