|
|
| | 4'-Benzyloxy-2'-hydroxyacetophenone Basic information |
| Product Name: | 4'-Benzyloxy-2'-hydroxyacetophenone | | Synonyms: | 4-Benzyloxy-2-Hydroxyacetophenone 4'-Benzyloxy-2'-Hydroxyacetophenone;1-[2-Hydroxy-4-(phenylmethoxy)phenyl]-ethanone;2-Hydroxy-4-(phenylmethoxy)acetophenone;4'-(Benzyloxy)resacetophenone;NSC 211460;1-[4-(benzyloxy)-2-hydroxyphenyl]ethan-1-one;Resacetophenone 4-benzyl ether;-Dimethoxyisoflavan) | | CAS: | 29682-12-0 | | MF: | C15H14O3 | | MW: | 242.27 | | EINECS: | | | Product Categories: | Aromatics | | Mol File: | 29682-12-0.mol |  |
| | 4'-Benzyloxy-2'-hydroxyacetophenone Chemical Properties |
| Melting point | 104-106°C | | Boiling point | 415.7±30.0 °C(Predicted) | | density | 1.187±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | powder to crystal | | pka | 9.79±0.10(Predicted) | | color | White to Light yellow to Dark green | | InChI | InChI=1S/C15H14O3/c1-11(16)14-8-7-13(9-15(14)17)18-10-12-5-3-2-4-6-12/h2-9,17H,10H2,1H3 | | InChIKey | AGQNLHOTLJFJCG-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(OCC2=CC=CC=C2)C=C1O)C |
| | 4'-Benzyloxy-2'-hydroxyacetophenone Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | Isolated from Gnetum ula. | | Preparation | Preparation by reaction of resacetophenone, with benzyl chloride,
in the presence of potassium carbonate in refluxing acetone. |
| | 4'-Benzyloxy-2'-hydroxyacetophenone Preparation Products And Raw materials |
|