|
| Inosine-5'-triphosphate trisodium salt Basic information |
| Inosine-5'-triphosphate trisodium salt Chemical Properties |
Melting point | >138°C (dec.) | storage temp. | -20°C | solubility | Methanol (Very Slightly, Heated, Sonicated), Water (Slightly) | form | Powder | color | White | Stability: | Hygroscopic | InChIKey | RIERCUPIZLBNFQ-JHVGCDEENA-N | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=NC2C(NC=NC1=2)=O)O.[NaH] |&1:1,2,3,19,r| |
| Inosine-5'-triphosphate trisodium salt Usage And Synthesis |
Uses | Inosine 5’ Triphosphate Trisodium Salt is used in studies where ATP and GTP are deaminated by various enzymes and biological processes. This can help with kinetics studies of enzymes as well. | Uses | Inosine 5’Triphosphate Trisodium Salt is used in studies where ATP and GTP are deaminated by various enzymes and biological processes. This can help with kinetics studies of enzymes as well. | Uses | Inosine 5′-triphosphate (ITP) is used in studies on the impact of deamination of ATP and GTP by various enzymes and chemical processes. ITP may be used as a substrate to study the specificity and kinetics of nucleoside-5′-triphosphatase and ATPase. ITP is also used to study activation of various ATPases and GTPases. | Biochem/physiol Actions | Inosine 5′-triphosphate (ITP) has the ability to support the initiation of effector system. It can prevent guanosine 5′-triphosphate (GTP) hydrolysis, that is catalysed by transducin (TD).?ITP can proficiently induce secretion in permeabilized cells than GTP. Instead of GTP, ITP can be used for the initiation and the elongation steps of reovirus transcription. ITP can also replace GTP in the activation of G-protein. |
| Inosine-5'-triphosphate trisodium salt Preparation Products And Raw materials |
|