- Tos-PEG4-Tos
-
- $0.00 / 500g
-
2024-03-27
- CAS:19249-03-7
- Min. Order: 500g
- Purity: >98.00%
- Supply Ability: 500g
|
| | Tri(Ethylene Glycol) DI-P-Toluenesulfonate Basic information |
| Product Name: | Tri(Ethylene Glycol) DI-P-Toluenesulfonate | | Synonyms: | 1,8-Bis(tosyloxy)-3,6-dioxaoctane;Bis(4-methylbenzenesulfonic acid)3,6-dioxa-1,8-octanediyl ester;Bis(4-methylbenzenesulfonic acid)ethylenebis(oxyethylene) ester;Bis(p-toluenesulfonic acid)ethylenebisoxybisethylene ester;Triethylene glycol di-p-tosylate,98%;Triethleneglycol ditosylate;Triethylene glycol ditoluenesulfonate.;ETHANOL22OXYBIS21ETHANEDIYLOXYBISBIS4METHYLBENZENESULPHONATE | | CAS: | 19249-03-7 | | MF: | C20H26O8S2 | | MW: | 458.55 | | EINECS: | 628-844-0 | | Product Categories: | | | Mol File: | 19249-03-7.mol |  |
| | Tri(Ethylene Glycol) DI-P-Toluenesulfonate Chemical Properties |
| Melting point | 78-82 °C(lit.) | | Boiling point | 534.03°C (rough estimate) | | density | 1.3164 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in ethanol. | | form | powder to crystal | | color | White to Almost white | | BRN | 632509 | | InChI | InChI=1S/C20H26O8S2/c1-17-3-7-19(8-4-17)29(21,22)27-15-13-25-11-12-26-14-16-28-30(23,24)20-9-5-18(2)6-10-20/h3-10H,11-16H2,1-2H3 | | InChIKey | KCONMNWPRXAWKK-UHFFFAOYSA-N | | SMILES | C(OCCOS(C1=CC=C(C)C=C1)(=O)=O)COCCOS(C1=CC=C(C)C=C1)(=O)=O | | CAS DataBase Reference | 19249-03-7(CAS DataBase Reference) | | EPA Substance Registry System | Ethanol, 2,2'-[1,2-ethanediylbis(oxy)]bis-, bis(4-methylbenzenesulfonate) (19249-03-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29093090 |
| | Tri(Ethylene Glycol) DI-P-Toluenesulfonate Usage And Synthesis |
| Description | Tos-PEG4-Tos is a PEG linker containing two tosyl groups. The hydrophilic PEG spacer increases solubility in aqueous media. The tosyl group is a very good leaving group for nucleophilic substitution reactions. | | Chemical Properties | WHITE POWDER | | Uses | Tri(ethylene glycol) di-p-toluenesulfonate is used in the synthesis of 1-[4-(1,4,7,10-tetraoxa-13-aza-cyclopentadec-13-yl)-phenyl] ethanone. | | Synthesis |
2,2'-[1,2-ethanediylbis(oxy)]bisethanol and p-toluenesulfonyl chloride can be used as raw materials for the synthesis of Tri(Ethylene Glycol) DI-P-Toluenesulfonate.
|
| | Tri(Ethylene Glycol) DI-P-Toluenesulfonate Preparation Products And Raw materials |
|