|
|
| | (Triphenylphosphoranylidene)acetonitrile Basic information |
| | (Triphenylphosphoranylidene)acetonitrile Chemical Properties |
| Melting point | 189-195 °C (lit.) | | Boiling point | 465.3±28.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | Fp | >110°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C20H16NP/c21-16-17-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,17H | | InChIKey | APISVOVOJVZIBA-UHFFFAOYSA-N | | SMILES | C(#N)C=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 2811 6.1/PG III | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (Triphenylphosphoranylidene)acetonitrile Usage And Synthesis |
| Chemical Properties | off-white to light yellow crystalline powder | | Uses | (Triphenylphosphoranylidene)acetonitrile is a reactant in the synthesis of largazole analogues which displays potent cell growth inhibition and cytotoxicity. As well, is used in the synthesis of monoterpene derivatives against leukemia. | | Acquired resistance | (Triphenylphosphoranylidene)acetonitrile may be generated by deprotonation of the corresponding phosphonium salt, by cyanation of Methylenetriphenylphosphorane with p-tolyl cyanate, or by the reaction of Acrylonitrile with (Methoxycarbonylmethylene)triphenylphosphorane.
 | | reaction suitability | reaction type: C-C Bond Formation |
| | (Triphenylphosphoranylidene)acetonitrile Preparation Products And Raw materials |
|