| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Chloro-4-fluorobenzylamine Basic information |
| Product Name: | 2-Chloro-4-fluorobenzylamine | | Synonyms: | RARECHEM AL BW 0478;2-Chloro-4-Florobenzylamine;2-Chloro-4-fluorobenzylamine, tech. 90%;2-Chloro-4-fluorobenzylamine 97%;2-Chloro-4-fluorobenzylamine97%;(2-Chloro-4-fluorophenyl)methylamine;Benzenemethanamine, 2-chloro-4-fluoro-;(2-CHLORO-4-FLUOROPHENYL)METHANAMINE | | CAS: | 15205-11-5 | | MF: | C7H7ClFN | | MW: | 159.59 | | EINECS: | 670-919-5 | | Product Categories: | Fluorine series;Miscellaneous | | Mol File: | 15205-11-5.mol |  |
| | 2-Chloro-4-fluorobenzylamine Chemical Properties |
| Melting point | 172-173 °C(Solv: N,N-dimethylformamide (68-12-2)) | | Boiling point | 94 °C | | density | 1.270±0.06 g/cm3(Predicted) | | refractive index | 1.535 | | Fp | >110°C | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.46±0.10(Predicted) | | form | liquid | | color | Clear, colourless | | Sensitive | Air Sensitive | | BRN | 2936421 | | InChI | InChI=1S/C7H7ClFN/c8-7-3-6(9)2-1-5(7)4-10/h1-3H,4,10H2 | | InChIKey | CBKWAXKMZUULLO-UHFFFAOYSA-N | | SMILES | C1(CN)=CC=C(F)C=C1Cl | | CAS DataBase Reference | 15205-11-5(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39 | | RIDADR | 2735 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2921490090 |
| Provider | Language |
|
ALFA
| English |
| | 2-Chloro-4-fluorobenzylamine Usage And Synthesis |
| Uses | 2-chloro-4-fluorobenzylamine is employed to react with 1-(2-nitrophenyl)pyrrole derivatives to synthesize the corresponding pyrrolo[1,2-a]quinoxaline derivatives.1 | | References | [1] Sun, Q., Liu, L., Yang, Y., Zha, Z., & Wang, Z. (2019). Unexpected activated carbon-catalyzed pyrrolo[1,2-a]quinoxalines synthesis in water. Chinese Chemical Letters, 30 7, Pages 1379-1382. https://doi.org/10.1016/j.cclet.2019.04.007 |
| | 2-Chloro-4-fluorobenzylamine Preparation Products And Raw materials |
|