- O-METHYL-D-TYROSINE
-
- $1.00 / 1kg
-
2019-07-06
- CAS:39878-65-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 100KG
|
| | O-METHYL-D-TYROSINE Basic information |
| | O-METHYL-D-TYROSINE Chemical Properties |
| Melting point | 262-263 °C (decomp) | | Boiling point | 350.6±32.0 °C(Predicted) | | density | 1.209±0.06 g/cm3(Predicted) | | storage temp. | Store at RT. | | solubility | Aqueous Acid (Slightly), Water (Slightly) | | pka | 2.24±0.10(Predicted) | | form | Solid | | color | White to Almost white | | Optical Rotation | [α]20/D +7.0±1°, c =1% in 5 M HCl | | InChI | 1S/C10H13NO3/c1-14-8-4-2-7(3-5-8)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m1/s1 | | InChIKey | GEYBMYRBIABFTA-SECBINFHSA-N | | SMILES | COc1ccc(C[C@@H](N)C(O)=O)cc1 | | CAS DataBase Reference | 39878-65-4(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2922.49.4950 | | Storage Class | 13 - Non Combustible Solids |
| | O-METHYL-D-TYROSINE Usage And Synthesis |
| Chemical Properties | White powder | | Uses | (R)-2-Amino-3-(4-methoxyphenyl)propanoic acid is a catecholamine agonist. | | Definition | ChEBI: O-methyl-D-tyrosine is the D-enantiomer of O-methyltyrosine. It is an enantiomer of an O-methyl-L-tyrosine. |
| | O-METHYL-D-TYROSINE Preparation Products And Raw materials |
|