|
|
| | 2-AMINO-3,4,5-TRIMETHOXYBENZOIC ACID Basic information |
| Product Name: | 2-AMINO-3,4,5-TRIMETHOXYBENZOIC ACID | | Synonyms: | 3,4,5-TRIMETHOXYANTHRANILIC ACID;2-AMINO-3,4,5-TRIMETHOXYBENZOIC ACID;BUTTPARK 121\04-66;Benzoic acid, 2-amino-3,4,5-trimethoxy-;Einecs 263-344-2;4-[(E)-2-(3-nitrophenyl)ethenyl]cinnoline;2-Amino-3,4,5-trimethoxybenzoicAcid>2-AMINO-3,4,5-TRIMETHOXYBENZOIC ACID USP/EP/BP | | CAS: | 61948-85-4 | | MF: | C10H13NO5 | | MW: | 227.21 | | EINECS: | 263-344-2 | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Aromatic Amino Acids;Peptide Synthesis;Unnatural Amino Acid Derivatives | | Mol File: | 61948-85-4.mol |  |
| | 2-AMINO-3,4,5-TRIMETHOXYBENZOIC ACID Chemical Properties |
| Melting point | 137-141 °C (lit.) | | Boiling point | 371.0±42.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | powder to crystal | | pka | 2.23±0.10(Predicted) | | color | White to Light yellow | | λmax | 339nm(EtOH)(lit.) | | BRN | 3353856 | | Major Application | peptide synthesis | | InChI | 1S/C10H13NO5/c1-14-6-4-5(10(12)13)7(11)9(16-3)8(6)15-2/h4H,11H2,1-3H3,(H,12,13) | | InChIKey | JSHSRQCOCMIIPA-UHFFFAOYSA-N | | SMILES | COc1cc(C(O)=O)c(N)c(OC)c1OC | | CAS DataBase Reference | 61948-85-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 28-36/37 | | WGK Germany | 3 | | HS Code | 2922.49.8000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 2-AMINO-3,4,5-TRIMETHOXYBENZOIC ACID Usage And Synthesis |
| Uses | 2-Amino-3,4,5-trimethoxybenzoic Acid is a useful raw material for the chemical and pharmaceutical industry. | | reaction suitability | reaction type: solution phase peptide synthesis | | Synthesis | 2-Amino-3,4,5-trimethoxybenzoic acid can be prepared from methyl 3,4,5-trimethoxybenzoate as the reaction raw material by nitration to prepare the intermediate methyl 3,4,5-trimethoxy-2-nitrobenzoate, further reaction to prepare the intermediate 3,4,5-trimethoxy-2-nitrobenzoic acid, and after that, it is prepared by tin powder reduction.
|
| | 2-AMINO-3,4,5-TRIMETHOXYBENZOIC ACID Preparation Products And Raw materials |
|