| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
6-Methyl-1-octanol manufacturers
- 6-METHYLOCTAN-1-OL
-
- $2.20
-
2026-08-25
- CAS:38514-05-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 50kg
|
| | 6-Methyl-1-octanol Basic information |
| Product Name: | 6-Methyl-1-octanol | | Synonyms: | 6-methyloctanol;1-Octanol, 6-methyl-;6-methyl-1-octylol;6-methyloctan-1-ol;6-Methyl-1-octanol | | CAS: | 38514-05-5 | | MF: | C9H20O | | MW: | 144.25 | | EINECS: | 253-977-2 | | Product Categories: | | | Mol File: | 38514-05-5.mol |  |
| | 6-Methyl-1-octanol Chemical Properties |
| Melting point | 6.15°C (estimate) | | Boiling point | 197℃ | | density | 0.824 | | refractive index | 1.4340 | | Fp | 80℃ | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | pka | 15.20±0.10(Predicted) | | form | Oil | | color | Colourless | | Henry's Law Constant | 4.3×10-2 mol/(m3Pa) at 25℃, Yaws (2003) | | InChI | InChI=1S/C9H20O/c1-3-9(2)7-5-4-6-8-10/h9-10H,3-8H2,1-2H3 | | InChIKey | WWRGKAMABZHMCN-UHFFFAOYSA-N | | SMILES | C(O)CCCCC(C)CC |
| | 6-Methyl-1-octanol Usage And Synthesis |
| Uses | 6-Methyl-1-octanol is a useful research chemical that can be used to prepare a quantum dot light-emitting diode, as well as a low-viscose miktoarm star-shaped hydroxy resin for coatings. |
| | 6-Methyl-1-octanol Preparation Products And Raw materials |
|