|
|
| | 1,2,4-Trifluoro-5-nitrobenzene Basic information |
| Product Name: | 1,2,4-Trifluoro-5-nitrobenzene | | Synonyms: | 2,4,5-Trifluoro-1-nitrobenzene;1,2,4-TRIFLUORO-5-NITROBENZENE;Benzene, 1,2,4-trifluoro-5-nitro;2,4,5-Trifluoro-5-nitrobenzene;1-Nitro-2,4,5-trifluorobenzene;4-chloro-2-flurophenol;2,4,5-Trifluoronitrobenzene 98%;2,4,5-Trifluoronitrobenzene98% | | CAS: | 2105-61-5 | | MF: | C6H2F3NO2 | | MW: | 177.08 | | EINECS: | 218-281-5 | | Product Categories: | Fluorine series;Aromatic Hydrocarbons (substituted) & Derivatives;Miscellaneous;bc0001 | | Mol File: | 2105-61-5.mol |  |
| | 1,2,4-Trifluoro-5-nitrobenzene Chemical Properties |
| Melting point | -11 °C (lit.) | | Boiling point | 194-195 °C (lit.) | | density | 1.544 g/mL at 25 °C (lit.) | | refractive index | 1.493-1.495 | | Fp | 89 °C | | storage temp. | 2-8°C | | form | clear liquid | | color | Light yellow to Brown to Dark green | | Specific Gravity | 1.56 | | BRN | 2504370 | | InChI | InChI=1S/C6H2F3NO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H | | InChIKey | ROJNMGYMBLNTPK-UHFFFAOYSA-N | | SMILES | C1(F)=CC([N+]([O-])=O)=C(F)C=C1F | | CAS DataBase Reference | 2105-61-5(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1,2,4-trifluoro-5-nitro-(2105-61-5) |
| Hazard Codes | Xn,Xi,T | | Risk Statements | 36/37/38-20/21/22-25 | | Safety Statements | 36/37/39-26-45-37/39 | | RIDADR | UN 2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2,4-Trifluoro-5-nitrobenzene Usage And Synthesis |
| Chemical Properties | clear brown liquid | | Uses | 1,2,4-Trifluoro-5-nitrobenzene is used as a raw material in organic synthesis for the preparation of other benzene derivatives. |
| | 1,2,4-Trifluoro-5-nitrobenzene Preparation Products And Raw materials |
| Preparation Products | 2,5-Difluorophenylene-1,4-diamine, 1,4-Diamino-2,5-difluorobenzene-->Benzenamine, 4,5-difluoro-N-methyl-2-nitro--->Pyridine,2-chloro-4-(2,5-difluoro-4-nitrophenoxy)--->1,2-Benzenediamine, N1-ethyl-4,5-difluoro- |
|