|
|
| | 2-HYDROXY-5-NITROBENZYL BROMIDE Basic information |
| | 2-HYDROXY-5-NITROBENZYL BROMIDE Chemical Properties |
| Melting point | 144-149 °C(lit.) | | Boiling point | 383.0±32.0 °C(Predicted) | | density | 1.795 | | refractive index | 1.6090 (estimate) | | storage temp. | 2-8°C | | solubility | chloroform: soluble25mg/mL, clear, yellow | | form | Crystalline Powder | | pka | 6.16±0.30(Predicted) | | color | Beige to light brown | | BRN | 1868798 | | InChI | InChI=1S/C7H6BrNO3/c8-4-5-3-6(9(11)12)1-2-7(5)10/h1-3,10H,4H2 | | InChIKey | KFDPCYZHENQOBV-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C([N+]([O-])=O)C=C1CBr | | CAS DataBase Reference | 772-33-8(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 2-(bromomethyl)-4-nitro- (772-33-8) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29089990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-HYDROXY-5-NITROBENZYL BROMIDE Usage And Synthesis |
| Chemical Properties | Beige to yellow crystalline powder | | Uses | 2-Hydroxy-5-nitrobenzyl bromide was used in covalent modification of tryptophan and tryptophan residues in monoclonal immunoglobulin. It was also used as reagent for sulfhydryl modification | | Uses | Reagent for sulfhydryl modification.1 | | Uses | 2-Hydroxy-5-nitrobenzyl bromide is a chemical reagent that reacts with and modifies chemically the tryptophan portion of protein molecules.. | | Synthesis Reference(s) | Journal of the American Chemical Society, 86, p. 1448, 1964 DOI: 10.1021/ja01061a045 | | General Description | 2-Hydroxy-5-nitrobenzyl bromide is a protein modifying reagent. | | Purification Methods | Crystallise the bromide from *benzene or *benzene/ligroin. It is slightly soluble in EtOH, soluble in *C6H6 and AcOH, and very soluble in ligroin. [Beilstein 6 H 367.] |
| | 2-HYDROXY-5-NITROBENZYL BROMIDE Preparation Products And Raw materials |
|