|
|
| | N-(p-Sulfamoylphenethyl)acetamide Basic information |
| Product Name: | N-(p-Sulfamoylphenethyl)acetamide | | Synonyms: | N-ACETYL-4-(2-AMINOETHYL)-BENZENESULFONAMIDE;N-ACETYL (2-AMINOETHYL)BENZENE SULPHONAMIDE;4-(2-acetylaminoethyl)benzenesulfonamide;N-[2-[4-(aminosulphonyl)phenyl]ethyl]acetamide;4-[2-(N-Acetylamino)-ethyl]-benzenesulfonamide;4-[N-Acetyl-2-(aminoethyl)]benzenesulphonamide 96%;N-[2-(4-Sulphamoylphenyl)ethyl]acetamide;4-[N-Acetyl-2-(aminoethyl)]benzenesulphonamide | | CAS: | 41472-49-5 | | MF: | C10H14N2O3S | | MW: | 242.29 | | EINECS: | 255-386-5 | | Product Categories: | | | Mol File: | 41472-49-5.mol |  |
| | N-(p-Sulfamoylphenethyl)acetamide Chemical Properties |
| Melting point | 168-174°C | | density | 1.274±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 10.16±0.10(Predicted) | | InChI | InChI=1S/C10H14N2O3S/c1-8(13)12-7-6-9-2-4-10(5-3-9)16(11,14)15/h2-5H,6-7H2,1H3,(H,12,13)(H2,11,14,15) | | InChIKey | IIMGUEXQORZTID-UHFFFAOYSA-N | | SMILES | C(NCCC1=CC=C(S(N)(=O)=O)C=C1)(=O)C | | CAS DataBase Reference | 41472-49-5(CAS DataBase Reference) |
| | N-(p-Sulfamoylphenethyl)acetamide Usage And Synthesis |
| Uses | N-[2-[4-(Aminosulfonyl)phenyl]ethyl]-acetamide is used in the synthesis of sulfonylurea and thiourea derivatives substituted with benzenesulfonamide groups that can be used as potential hypoglycemic agents. |
| | N-(p-Sulfamoylphenethyl)acetamide Preparation Products And Raw materials |
|