| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Chloroquinoline-3-boronic acid Basic information |
| Product Name: | 2-Chloroquinoline-3-boronic acid | | Synonyms: | (2-CHLOROQUINOLIN-3-YL)BORONIC ACID;2-CHLORO-3-QUINOLYL BORONIC ACID;2-Chloro-3-quinoline boronic acid;(2-chloro-3-quinolinyl)boronic acid(SALTDATA: FREE);3-Borono-2-chloroquinoline;Boronic acid, (2-chloro-3-quinolinyl)-;(2-Chloro-3-quinolinyl)boronic acid;2-Chloroquinolin-3-boronic acid | | CAS: | 128676-84-6 | | MF: | C9H7BClNO2 | | MW: | 207.42 | | EINECS: | | | Product Categories: | Boronic acid;Organoborons;Quinoline | | Mol File: | 128676-84-6.mol |  |
| | 2-Chloroquinoline-3-boronic acid Chemical Properties |
| Melting point | 144-147℃ | | Boiling point | 426.2±55.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | pka | 5.62±0.30(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H7BClNO2/c11-9-7(10(13)14)5-6-3-1-2-4-8(6)12-9/h1-5,13-14H | | InChIKey | JAQXYUOPSOXQCG-UHFFFAOYSA-N | | SMILES | B(C1=CC2C(N=C1Cl)=CC=CC=2)(O)O | | CAS DataBase Reference | 128676-84-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2933499090 |
| Provider | Language |
|
ALFA
| English |
| | 2-Chloroquinoline-3-boronic acid Usage And Synthesis |
| Uses | 2-Chloroquinoline-3-Boronic acid can be converted to 2-chloro-3-hydroxyquinoline in 98% yield by oxidizing with ammonium chloride in aqueous solution with peroxide. Further hydrolysis of 2-chloro-3-hydroxyquinoline yields 3-hydroxy-2-quinolinone. | | Synthesis | 2-Chloroquinoline was lithiated with lithium diisopropylamide in a low-temperature tetrahydrofuran solution, followed by the addition of trimethylborate ester, and finally acidification to obtain 2-Chloroquinoline-3-boronic acid in 85% yield. | | References | [1] Marsais, F., Godard, A., & Queguiner, G. (1989). Directed ortho-lithiation of chloroquinolines. Application to synthesis of 2,3-disubstituted quinolines. Journal of Heterocyclic Chemistry, 26 6, 1589–1594. https://doi.org/10.1002/jhet.5570260615 |
| | 2-Chloroquinoline-3-boronic acid Preparation Products And Raw materials |
|