|
|
| | 5-Chlorosalicylaldehyde Basic information |
| | 5-Chlorosalicylaldehyde Chemical Properties |
| Melting point | 100-102 °C(lit.) | | Boiling point | 217.69°C (rough estimate) | | density | 1.2683 (rough estimate) | | refractive index | 1.5812 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 7.73±0.18(Predicted) | | form | Crystalline Powder | | color | White to very slightly yellow | | Sensitive | Air Sensitive | | BRN | 636632 | | InChI | InChI=1S/C7H5ClO2/c8-6-1-2-7(10)5(3-6)4-9/h1-4,10H | | InChIKey | FUGKCSRLAQKUHG-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(Cl)=CC=C1O | | LogP | 2.570 (est) | | CAS DataBase Reference | 635-93-8(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Chloro-2-hydroxy benzaldehyde(635-93-8) | | EPA Substance Registry System | Benzaldehyde, 5-chloro-2-hydroxy- (635-93-8) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36-24/25-36/37/39 | | RIDADR | UN2811/6.1/PG III | | WGK Germany | 3 | | RTECS | VN5450000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 9 | | HS Code | 29130000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Chlorosalicylaldehyde Usage And Synthesis |
| Chemical Properties | white to very slightly yellow crystalline powder | | Uses | 5-Chlorosalicyaldehyde is a useful synthetic intermediate and a key precursor to a variety chelating agents.5-Chlorosalicyaldehyde is used to synthesize imine resveratrol (R150000) derivatives as multi-targeted agents against Alzheimer's disease. | | Synthesis Reference(s) | Synthetic Communications, 20, p. 609, 1990 DOI: 10.1080/00397919008244911 Tetrahedron Letters, 15, p. 3463, 1974 | | Purification Methods | Steam distil it, then crystallise it from aqueous EtOH or *C6H6 (m 100o). It forms complexes with Cu2+ and Fe2+ . [Beilstein 8 H 53, 8 II 45, 8 III 181, 8 IV 224.] |
| | 5-Chlorosalicylaldehyde Preparation Products And Raw materials |
|