|
|
| | 2,2'-Bipyridine-3,3'-dicarboxylic acid Basic information |
| Product Name: | 2,2'-Bipyridine-3,3'-dicarboxylic acid | | Synonyms: | 2,2'-Bipyridine-3,3'-dicarboxylic acid;2,2Bipyridyl-3,3'-dicarboxylic acid;2,2'-Binicotinic Acid;2'-Bipyridyl-3,3'-dicarboxylic acid;Butanoic acid, 4-amino-4-(2,6-dioxocyclohexylidene)-;3,3'-bis(hydroxycarbonyl)-2,2'-bipyridine;2,2'-Bipyridine-3,3'-dicarboxylicAci;2,2'-Bipyridine-3,3'-dicarboxylic acid ISO 9001:2015 REACH | | CAS: | 4433-01-6 | | MF: | C12H8N2O4 | | MW: | 244.2 | | EINECS: | 626-820-4 | | Product Categories: | Heterocyclic Compounds;C9 to C46;Heterocyclic Building Blocks;Pyridines | | Mol File: | 4433-01-6.mol |  |
| | 2,2'-Bipyridine-3,3'-dicarboxylic acid Chemical Properties |
| Melting point | 261°C(dec.)(lit.) | | Boiling point | 454.1±40.0 °C(Predicted) | | density | 1.469±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 1.40±0.36(Predicted) | | color | White to Almost white | | InChI | 1S/C12H8N2O4/c15-11(16)7-3-1-5-13-9(7)10-8(12(17)18)4-2-6-14-10/h1-6H,(H,15,16)(H,17,18) | | InChIKey | KNVZVRWMLMPTTJ-UHFFFAOYSA-N | | SMILES | OC(=O)c1cccnc1-c2ncccc2C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,2'-Bipyridine-3,3'-dicarboxylic acid Usage And Synthesis |
| Definition | ChEBI: 2-(3-carboxy-2-pyridinyl)-3-pyridinecarboxylic acid is a member of bipyridines. | | Synthesis | Example 4: 9.50 g of 2-chloronicotinic acid and 5.30 g of sodium hydroxide were dissolved in a solvent mixture of 40 mL of water and 40 mL of methanol. After the addition of 4 g of palladium/activated carbon catalyst with 5% palladium loading, the reaction mixture was stirred at 80-85°C and 0.1 MPa for 30 hours. Upon completion of the reaction, the catalyst was removed by filtration. Subsequently, the filtrate was acidified to pH 1 with hydrochloric acid to precipitate the target product 2,2'-bipyridine-3,3'-dicarboxylic acid as a white solid. A final 3.5 g of product was obtained in 48% yield. | | References | [1] Patent: US6500956, 2002, B1 |
| | 2,2'-Bipyridine-3,3'-dicarboxylic acid Preparation Products And Raw materials |
|