| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Tetrabutylammonium fluoride manufacturers
|
| | Tetrabutylammonium fluoride Basic information |
| | Tetrabutylammonium fluoride Chemical Properties |
| Melting point | 62-63 °C(lit.) | | density | 0.953 g/mL at 25 °C | | refractive index | n20/D 1.456 | | Fp | 1 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Methanol (Slightly), Water (Slightly) | | form | crystal | | color | white | | Merck | 14,9187 | | BRN | 3570522 | | Stability: | hygroscopic | | InChI | 1S/C16H36N.FH.H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;1H;1H2/q+1;;/p-1 | | InChIKey | UQCWXKSHRQJGPH-UHFFFAOYSA-M | | SMILES | O.[F-].CCCC[N+](CCCC)(CCCC)CCCC | | CAS DataBase Reference | 22206-57-1(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 2924 3/PG 2 | | WGK Germany | 3 | | F | 3 | | TSCA | No | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29239000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | Tetrabutylammonium fluoride Usage And Synthesis |
| Uses | Reactant for preparation of:
- Double clathrate hydrates at high pressures
- Cellulose ethers
- Terminal olefins via dehydrohalogenation reactions
- Neutral and zwitterionic 3-carboranyl thymidine analogues for boron neutron capture therapy
| | General Description | Tetrabutylammonium fluoride hydrate is known to be a source of F anion, used in nucleophilic fluorination reactions. |
| | Tetrabutylammonium fluoride Preparation Products And Raw materials |
|