|
|
| | 4-Methylumbelliferyl-beta-D-lactoside Basic information |
| Product Name: | 4-Methylumbelliferyl-beta-D-lactoside | | Synonyms: | 4-METHYLUMBELLIFERYL-BETA-D-LACTOSIDE, F OR FLUORESCENCE;4-Methylumbelliferyl--D-lactoside;4-methylumbelliferyl β-d-lactopyranoside;4-MU-BETA-D-LACTOSIDE;4-METHYLUMBELLIFERYL-B-D-LACTOSIDE;4-METHYLUMBELLIFERYL BETA-D-LACTOPYRANOSIDE;4-Methylumbelliferyl β-D-lactopyranoside ,98%;Galβ1-4GlcβMU | | CAS: | 84325-23-5 | | MF: | C22H28O13 | | MW: | 500.45 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 84325-23-5.mol |  |
| | 4-Methylumbelliferyl-beta-D-lactoside Chemical Properties |
| Melting point | >178°C (dec.) | | storage temp. | -20°C | | solubility | DMF: soluble | | form | Solid | | color | White to Off-White | | Water Solubility | water: 9.80-10.20mg/mL, clear, colorless to faintly yellow | | BRN | 8094402 | | InChIKey | PRTGXBPFDYMIJH-LTRTYOHLNA-N | | SMILES | C12OC(C=C(C)C=1C=CC(O[C@H]1[C@H](O)[C@H]([C@H](O[C@H]3[C@H](O)[C@H]([C@@H](O)[C@@H](CO)O3)O)[C@@H](CO)O1)O)=C2)=O |&1:11,12,14,15,17,18,20,21,23,28,r| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25-22 | | WGK Germany | 3 | | F | 8-10 | | HS Code | 29322090 | | Storage Class | 11 - Combustible Solids |
| | 4-Methylumbelliferyl-beta-D-lactoside Usage And Synthesis |
| Uses | 4-Methylumbelliferyl-β-D-lactoside (CAS# 84325-23-5) is a fluorescent coumarin glycoside, used in the preparation of fluorescent probes for sialidases and sialyltransferases. | | Uses | 4-Methylumbelliferyl β-D-lactopyranoside has been used as a chromophoric substrate for cellobiohydrolase I (CBHI) in T. reesei. It has also been used as a substrate for cellobiohydrolase I (Cel7A), endoglucanase I (Cel7B) and β-glucosidase from fermented samples in enzymatic assay. | | Biochem/physiol Actions | 4-Methylumbelliferyl β-D-lactopyranoside is a fluorescence compound hydrolyzed by the enzyme β-glucosidase (βG) and CBH1 |
| | 4-Methylumbelliferyl-beta-D-lactoside Preparation Products And Raw materials |
|