|
|
| | Magnesium trifluoromethanesulfonate Basic information |
| | Magnesium trifluoromethanesulfonate Chemical Properties |
| Melting point | ≥300 °C (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | White | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | Hydrolytic Sensitivity | 6: forms irreversible hydrate | | BRN | 705578 | | Stability: | hygroscopic | | InChI | InChI=1S/CHF3O3S.Mg.2H/c2-1(3,4)8(5,6)7;;;/h(H,5,6,7);;; | | InChIKey | HSDQCTQMTOAPEW-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)S(O)(=O)=O.[Mg] | | CAS DataBase Reference | 60871-83-2(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36/37/38 | | Safety Statements | 26-36/37/39-45-36 | | RIDADR | UN 3261 8/PG 3 | | WGK Germany | 3 | | F | 3-10 | | Hazard Note | Corrosive/Hygroscopic | | TSCA | No | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Magnesium trifluoromethanesulfonate Usage And Synthesis |
| Chemical Properties | off-white to grey powder | | Uses | Magnesium trifluoromethanesulfonate is used as a component of the electrolyte, as lewis acid resulted in largely decreased and reversed enantioselectivities. | | Purification Methods | Wash it with CH2Cl2 and dry it at 125o/2hour and 3mmHg. [Corey & Shimoji Tetrahedron Lett 24 171 1983, Beilstein 3 IV 34.] |
| | Magnesium trifluoromethanesulfonate Preparation Products And Raw materials |
|