| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (S)-3-Amino-3-(3-nitro-phenyl)-propionic acid Basic information |
| | (S)-3-Amino-3-(3-nitro-phenyl)-propionic acid Chemical Properties |
| Boiling point | 384.5±37.0 °C(Predicted) | | density | 1.404±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.52±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | Optical Rotation | Consistent with structure | | Sensitive | Air Sensitive | | InChI | InChI=1/C9H10N2O4/c10-8(5-9(12)13)6-2-1-3-7(4-6)11(14)15/h1-4,8H,5,10H2,(H,12,13)/t8-/s3 | | InChIKey | SJBFILRQMRECCK-SBYBRXNCNA-N | | SMILES | [C@H](C1C=CC=C(N(=O)=O)C=1)(N)CC(=O)O |&1:0,r| |
| | (S)-3-Amino-3-(3-nitro-phenyl)-propionic acid Usage And Synthesis |
| | (S)-3-Amino-3-(3-nitro-phenyl)-propionic acid Preparation Products And Raw materials |
|