| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
- Octyl thioglucoside
-
-
2026-09-28
- CAS:85618-21-9
- Min. Order: 1G
- Purity: 98%min
- Supply Ability: 30kg/month
- Octyl thioglucoside
-
-
2026-06-30
- CAS:85618-21-9
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
|
| | Octyl thioglucoside Basic information |
| | Octyl thioglucoside Chemical Properties |
| Melting point | 125-131 °C | | alpha | -46 º (c=1, MeOH) | | Boiling point | 418.82°C (rough estimate) | | density | 1.1831 (rough estimate) | | refractive index | 1.5300 (estimate) | | storage temp. | −20°C | | solubility | ethanol: soluble50mg/mL, clear, colorless | | pka | 13.02±0.70(Predicted) | | form | crystalline | | color | White | | biological source | synthetic | | Optical Rotation | [α]/D -52 to -48°, c = 1 in ethanol | | Water Solubility | soluble | | BRN | 4182783 | | InChI | 1S/C14H28O5S/c1-2-3-4-5-6-7-8-20-14-13(18)12(17)11(16)10(9-15)19-14/h10-18H,2-9H2,1H3 | | InChIKey | CGVLVOOFCGWBCS-RQASJOBOSA-N | | SMILES | S(C1OC(C(C(C1O)O)O)CO)CCCCCCCC | | CAS DataBase Reference | 85618-21-9(CAS DataBase Reference) |
| | Octyl thioglucoside Usage And Synthesis |
| Chemical Properties | Colourless Waxy Semi-Solid | | Uses | A non-ionic detergent for solubilization and reconstitution of membrane proteins of Escherichia coli. | | Uses | resistant to b-glucosidases and has a wider pH stability range | | Definition | ChEBI: N-Octyl-beta-D-thioglucopyranoside is a S-glycosyl compound. |
| | Octyl thioglucoside Preparation Products And Raw materials |
|