|
|
| | Celecoxib Impurity Basic information |
| Product Name: | Celecoxib Impurity | | Synonyms: | 4-[5-(2,4-Dimethyl-phenyl)-3-trifluoromethyl-pyrazol-1-yl]-benzenesulfonamide;Celecoxib-003;Celecoxib Impurity C: 2,3-dimethylcelecoxib;4-(5-(2,4-dimethylphenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl)benzenesulfonamide;4-(5-(2,4-dimethylphenyl);Celecoxib-14;Celecoxib 2,4-Dimethyl;Benzenesulfonamide, 4-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]- | | CAS: | 170570-09-9 | | MF: | C18H16F3N3O2S | | MW: | 395.4 | | EINECS: | | | Product Categories: | | | Mol File: | 170570-09-9.mol |  |
| | Celecoxib Impurity Chemical Properties |
| Boiling point | 521.9±60.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 9.68±0.10(Predicted) | | form | Solid | | color | Off-White to Pale Beige | | InChI | InChI=1S/C18H16F3N3O2S/c1-11-3-8-15(12(2)9-11)16-10-17(18(19,20)21)23-24(16)13-4-6-14(7-5-13)27(22,25)26/h3-10H,1-2H3,(H2,22,25,26) | | InChIKey | CDMHSMOZNZFYIK-UHFFFAOYSA-N | | SMILES | C1(S(N)(=O)=O)=CC=C(N2C(C3=CC=C(C)C=C3C)=CC(C(F)(F)F)=N2)C=C1 |
| | Celecoxib Impurity Usage And Synthesis |
| Uses | 2-Methyl-Celecoxib is an analog of the anti-inflammatory drug Celecoxib (C251000). Celecoxib is a selective cyclooxygenase-2 (COX-2) inhibitor. | | Uses | Celecoxib Impurity is also called 2-Methyl-Celecoxib, which is an impurity of the drug Celecoxib. It can be used as an impurity reference for testing the quality of drugs, and is often used in pharmaceutical production. |
| | Celecoxib Impurity Preparation Products And Raw materials |
|