|
|
| | TIN (II) ACETYLACETONATE Basic information |
| Product Name: | TIN (II) ACETYLACETONATE | | Synonyms: | 4-pentanedionato-.kappa.o,.kappa.o’)-bis((t-4)-ti;STANNOUS ACETYLACETONATE;TIN(II)-2,4-PENTANEDIONATE;TIN (II) ACETYLACETONATE;bis(pentane-2,4-dionato)tin;Bis[2,4-pentanedionato] tin;Tin bis[acetylacetonate];Bis(acetylacetonate)tin | | CAS: | 16009-86-2 | | MF: | C10H14O4Sn | | MW: | 316.93 | | EINECS: | 240-142-2 | | Product Categories: | | | Mol File: | 16009-86-2.mol |  |
| | TIN (II) ACETYLACETONATE Chemical Properties |
| Melting point | -25 to -19°C | | Boiling point | 100-5°C/0.02mmHg | | density | 1.3 | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | liquid | | color | yellow | | Specific Gravity | 1.30 | | Sensitive | moisture sensitive | | InChI | InChI=1S/2C5H7O2.Sn/c2*1-4(6)3-5(2)7;/h2*3H,1-2H3;/q2*-1;+2 | | InChIKey | BKPOZEUYGRNIRJ-UHFFFAOYSA-N | | SMILES | CC1[CH-]C(=[O][Sn+2]2([O]=C([CH-]C(=[O]2)C)C)[O]=1)C | | EPA Substance Registry System | Tin, bis(2,4-pentanedionato-.kappa.O,.kappa.O')-, (T-4)- (16009-86-2) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | TIN (II) ACETYLACETONATE Usage And Synthesis |
| Uses | - Thin film deposition by atomic layer deposition (ALD)
- Atomic layer etching.
- For use intransistors and other integrated circuit components.
| | reaction suitability | core: tin |
| | TIN (II) ACETYLACETONATE Preparation Products And Raw materials |
|